C19H36N2 — CID 177134539
(2R)-2-methyl-4-(3-methylcyclobutyl)-1-(4-propan-2-ylcyclohexyl)piperazine (PubChem CID 177134539) has the molecular formula C19H36N2 and a molecular weight of 292.51 g/mol. Its IUPAC name is (2R)-2-methyl-4-(3-methylcyclobutyl)-1-(4-propan-2-ylcyclohexyl)piperazine.
| Compound Name | (2R)-2-methyl-4-(3-methylcyclobutyl)-1-(4-propan-2-ylcyclohexyl)piperazine |
|---|---|
| PubChem CID | 177134539 |
| Molecular Formula | C19H36N2 |
| Molecular Weight | 292.51 g/mol |
| Exact Mass | 292.29 |
| IUPAC Name | (2R)-2-methyl-4-(3-methylcyclobutyl)-1-(4-propan-2-ylcyclohexyl)piperazine |
| SMILES | CC1CC(N2CCN(C3CCC(C(C)C)CC3)[C@H](C)C2)C1 |
| InChI | InChI=1S/C19H36N2/c1-14(2)17-5-7-18(8-6-17)21-10-9-20(13-16(21)4)19-11-15(3)12-19/h14-19H,5-13H2,1-4H3/t15?,16-,17?,18?,19?/m1/s1 |
| InChIKey | XHAZYRAYSQOQSN-FCKMWZNQSA-N |
| XLogP | 4.01 |
| TPSA | 6.48 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 292.51 |
| LogP ≤ 5 | 4.01 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |