About (1-methylindazol-3-yl)-pyrrolidin-1-ylmethanone;4-(5-methyl-1,2,4-oxadiazol-3-yl)phenol
(1-methylindazol-3-yl)-pyrrolidin-1-ylmethanone;4-(5-methyl-1,2,4-oxadiazol-3-yl)phenol (PubChem CID 177135035) has the molecular formula C22H23N5O3
and a molecular weight of 405.46 g/mol. Its IUPAC name is (1-methylindazol-3-yl)-pyrrolidin-1-ylmethanone;4-(5-methyl-1,2,4-oxadiazol-3-yl)phenol.
Molecular Properties
| Compound Name | (1-methylindazol-3-yl)-pyrrolidin-1-ylmethanone;4-(5-methyl-1,2,4-oxadiazol-3-yl)phenol |
| PubChem CID | 177135035 |
| Molecular Formula | C22H23N5O3 |
| Molecular Weight | 405.46 g/mol |
| Exact Mass | 405.18 |
| IUPAC Name | (1-methylindazol-3-yl)-pyrrolidin-1-ylmethanone;4-(5-methyl-1,2,4-oxadiazol-3-yl)phenol |
| SMILES | Cc1nc(-c2ccc(O)cc2)no1.Cn1nc(C(=O)N2CCCC2)c2ccccc21 |
| InChI | InChI=1S/C13H15N3O.C9H8N2O2/c1-15-11-7-3-2-6-10(11)12(14-15)13(17)16-8-4-5-9-16;1-6-10-9(11-13-6)7-2-4-8(12)5-3-7/h2-3,6-7H,4-5,8-9H2,1H3;2-5,12H,1H3 |
| InChIKey | LEVKFVLKNLPRJW-UHFFFAOYSA-N |
| XLogP | 3.56 |
| TPSA | 97.28 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 30 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 405.46 |
| LogP ≤ 5 | 3.56 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
Analyze (1-methylindazol-3-yl)-pyrrolidin-1-ylmethanone;4-(5-methyl-1,2,4-oxadiazol-3-yl)phenol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (1-methylindazol-3-yl)-pyrrolidin-1-ylmethanone;4-(5-methyl-1,2,4-oxadiazol-3-yl)phenol?
The IUPAC name of (1-methylindazol-3-yl)-pyrrolidin-1-ylmethanone;4-(5-methyl-1,2,4-oxadiazol-3-yl)phenol (CID 177135035) is (1-methylindazol-3-yl)-pyrrolidin-1-ylmethanone;4-(5-methyl-1,2,4-oxadiazol-3-yl)phenol.
What is the SMILES notation for (1-methylindazol-3-yl)-pyrrolidin-1-ylmethanone;4-(5-methyl-1,2,4-oxadiazol-3-yl)phenol?
The canonical SMILES for (1-methylindazol-3-yl)-pyrrolidin-1-ylmethanone;4-(5-methyl-1,2,4-oxadiazol-3-yl)phenol is Cc1nc(-c2ccc(O)cc2)no1.Cn1nc(C(=O)N2CCCC2)c2ccccc21.
What is the InChIKey of (1-methylindazol-3-yl)-pyrrolidin-1-ylmethanone;4-(5-methyl-1,2,4-oxadiazol-3-yl)phenol?
The InChIKey is LEVKFVLKNLPRJW-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H15N3O.C9H8N2O2/c1-15-11-7-3-2-6-10(11)12(14-15)13(17)16-8-4-5-9-16;1-6-10-9(11-13-6)7-2-4-8(12)5-3-7/h2-3,6-7H,4-5,8-9H2,1H3;2-5,12H,1H3.
What are the key properties of (1-methylindazol-3-yl)-pyrrolidin-1-ylmethanone;4-(5-methyl-1,2,4-oxadiazol-3-yl)phenol?
(1-methylindazol-3-yl)-pyrrolidin-1-ylmethanone;4-(5-methyl-1,2,4-oxadiazol-3-yl)phenol has a molecular weight of 405.46 g/mol, XLogP of 3.56, 2 rotatable bonds, 1 hydrogen bond donors, and 7 hydrogen bond acceptors.
Where does this data come from?
All data for (1-methylindazol-3-yl)-pyrrolidin-1-ylmethanone;4-(5-methyl-1,2,4-oxadiazol-3-yl)phenol is sourced from PubChem (CID 177135035), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).