C39H39N5O4S — CID 177135470
2-[[5-[9-[4-(methanesulfonamido)phenyl]-2-oxobenzo[h][1,6]naphthyridin-1-yl]-N,2-dimethylanilino]methyl]-N-[(3S)-3-tricyclo[4.2.0.02,4]octanyl]prop-2-enamide (PubChem CID 177135470) has the molecular formula C39H39N5O4S and a molecular weight of 673.84 g/mol. Its IUPAC name is 2-[[5-[9-[4-(methanesulfonamido)phenyl]-2-oxobenzo[h][1,6]naphthyridin-1-yl]-N,2-dimethylanilino]methyl]-N-[(3S)-3-tricyclo[4.2.0.02,4]octanyl]prop-2-enamide.
| Compound Name | 2-[[5-[9-[4-(methanesulfonamido)phenyl]-2-oxobenzo[h][1,6]naphthyridin-1-yl]-N,2-dimethylanilino]methyl]-N-[(3S)-3-tricyclo[4.2.0.02,4]octanyl]prop-2-enamide |
|---|---|
| PubChem CID | 177135470 |
| Molecular Formula | C39H39N5O4S |
| Molecular Weight | 673.84 g/mol |
| Exact Mass | 673.27 |
| IUPAC Name | 2-[[5-[9-[4-(methanesulfonamido)phenyl]-2-oxobenzo[h][1,6]naphthyridin-1-yl]-N,2-dimethylanilino]methyl]-N-[(3S)-3-tricyclo[4.2.0.02,4]octanyl]prop-2-enamide |
| SMILES | C=C(CN(C)c1cc(-n2c(=O)ccc3cnc4ccc(-c5ccc(NS(C)(=O)=O)cc5)cc4c32)ccc1C)C(=O)NC1C2CC3CCC3C21 |
| InChI | InChI=1S/C39H39N5O4S/c1-22-5-13-29(19-34(22)43(3)21-23(2)39(46)41-37-32-18-26-8-14-30(26)36(32)37)44-35(45)16-10-27-20-40-33-15-9-25(17-31(33)38(27)44)24-6-11-28(12-7-24)42-49(4,47)48/h5-7,9-13,15-17,19-20,26,30,32,36-37,42H,2,8,14,18,21H2,1,3-4H3,(H,41,46) |
| InChIKey | HKHCKDUNOWLTNM-UHFFFAOYSA-N |
| XLogP | 6.04 |
| TPSA | 113.40 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 49 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 673.84 |
| LogP ≤ 5 | 6.04 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Polycyclic_aromatic_hydrocarbon_3', 'substructure': 'N/A'} |
|---|