About ethane;ethyl-dimethyl-[1-(trifluoromethyl)pyrazol-4-yl]-λ4-sulfane
ethane;ethyl-dimethyl-[1-(trifluoromethyl)pyrazol-4-yl]-λ4-sulfane (PubChem CID 177135707) has the molecular formula C10H19F3N2S
and a molecular weight of 256.34 g/mol. Its IUPAC name is ethane;ethyl-dimethyl-[1-(trifluoromethyl)pyrazol-4-yl]-λ4-sulfane.
Molecular Properties
| Compound Name | ethane;ethyl-dimethyl-[1-(trifluoromethyl)pyrazol-4-yl]-λ4-sulfane |
| PubChem CID | 177135707 |
| Molecular Formula | C10H19F3N2S |
| Molecular Weight | 256.34 g/mol |
| Exact Mass | 256.12 |
| IUPAC Name | ethane;ethyl-dimethyl-[1-(trifluoromethyl)pyrazol-4-yl]-λ4-sulfane |
| SMILES | CC.CCS(C)(C)c1cnn(C(F)(F)F)c1 |
| InChI | InChI=1S/C8H13F3N2S.C2H6/c1-4-14(2,3)7-5-12-13(6-7)8(9,10)11;1-2/h5-6H,4H2,1-3H3;1-2H3 |
| InChIKey | JCORMTHWIBYUCG-UHFFFAOYSA-N |
| XLogP | 3.83 |
| TPSA | 17.82 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 256.34 |
| LogP ≤ 5 | 3.83 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze ethane;ethyl-dimethyl-[1-(trifluoromethyl)pyrazol-4-yl]-λ4-sulfane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of ethane;ethyl-dimethyl-[1-(trifluoromethyl)pyrazol-4-yl]-λ4-sulfane?
The IUPAC name of ethane;ethyl-dimethyl-[1-(trifluoromethyl)pyrazol-4-yl]-λ4-sulfane (CID 177135707) is ethane;ethyl-dimethyl-[1-(trifluoromethyl)pyrazol-4-yl]-λ4-sulfane.
What is the SMILES notation for ethane;ethyl-dimethyl-[1-(trifluoromethyl)pyrazol-4-yl]-λ4-sulfane?
The canonical SMILES for ethane;ethyl-dimethyl-[1-(trifluoromethyl)pyrazol-4-yl]-λ4-sulfane is CC.CCS(C)(C)c1cnn(C(F)(F)F)c1.
What is the InChIKey of ethane;ethyl-dimethyl-[1-(trifluoromethyl)pyrazol-4-yl]-λ4-sulfane?
The InChIKey is JCORMTHWIBYUCG-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H13F3N2S.C2H6/c1-4-14(2,3)7-5-12-13(6-7)8(9,10)11;1-2/h5-6H,4H2,1-3H3;1-2H3.
What are the key properties of ethane;ethyl-dimethyl-[1-(trifluoromethyl)pyrazol-4-yl]-λ4-sulfane?
ethane;ethyl-dimethyl-[1-(trifluoromethyl)pyrazol-4-yl]-λ4-sulfane has a molecular weight of 256.34 g/mol, XLogP of 3.83, 2 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for ethane;ethyl-dimethyl-[1-(trifluoromethyl)pyrazol-4-yl]-λ4-sulfane is sourced from PubChem (CID 177135707), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).