C16H25N3O3 — CID 177137615
1-N,3-N,5-N-trimethyladamantane-1,3,5-tricarboxamide (PubChem CID 177137615) has the molecular formula C16H25N3O3 and a molecular weight of 307.39 g/mol. Its IUPAC name is 1-N,3-N,5-N-trimethyladamantane-1,3,5-tricarboxamide.
| Compound Name | 1-N,3-N,5-N-trimethyladamantane-1,3,5-tricarboxamide |
|---|---|
| PubChem CID | 177137615 |
| Molecular Formula | C16H25N3O3 |
| Molecular Weight | 307.39 g/mol |
| Exact Mass | 307.19 |
| IUPAC Name | 1-N,3-N,5-N-trimethyladamantane-1,3,5-tricarboxamide |
| SMILES | CNC(=O)C12CC3CC(C(=O)NC)(C1)CC(C(=O)NC)(C3)C2 |
| InChI | InChI=1S/C16H25N3O3/c1-17-11(20)14-4-10-5-15(7-14,12(21)18-2)9-16(6-10,8-14)13(22)19-3/h10H,4-9H2,1-3H3,(H,17,20)(H,18,21)(H,19,22) |
| InChIKey | VFOZOYWXWUDQMT-UHFFFAOYSA-N |
| XLogP | 0.18 |
| TPSA | 87.30 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 307.39 |
| LogP ≤ 5 | 0.18 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |