C23H26ClN5O2 — CID 177138258
5-[4-[4-(4-chlorobut-1-en-2-yl)-6,7-dimethylpteridin-2-yl]oxan-2-yl]-1-methylpyridin-2-one (PubChem CID 177138258) has the molecular formula C23H26ClN5O2 and a molecular weight of 439.95 g/mol. Its IUPAC name is 5-[4-[4-(4-chlorobut-1-en-2-yl)-6,7-dimethylpteridin-2-yl]oxan-2-yl]-1-methylpyridin-2-one.
| Compound Name | 5-[4-[4-(4-chlorobut-1-en-2-yl)-6,7-dimethylpteridin-2-yl]oxan-2-yl]-1-methylpyridin-2-one |
|---|---|
| PubChem CID | 177138258 |
| Molecular Formula | C23H26ClN5O2 |
| Molecular Weight | 439.95 g/mol |
| Exact Mass | 439.18 |
| IUPAC Name | 5-[4-[4-(4-chlorobut-1-en-2-yl)-6,7-dimethylpteridin-2-yl]oxan-2-yl]-1-methylpyridin-2-one |
| SMILES | C=C(CCCl)c1nc(C2CCOC(c3ccc(=O)n(C)c3)C2)nc2nc(C)c(C)nc12 |
| InChI | InChI=1S/C23H26ClN5O2/c1-13(7-9-24)20-21-23(26-15(3)14(2)25-21)28-22(27-20)16-8-10-31-18(11-16)17-5-6-19(30)29(4)12-17/h5-6,12,16,18H,1,7-11H2,2-4H3 |
| InChIKey | NKEHEHWEGGLSEH-UHFFFAOYSA-N |
| XLogP | 4.01 |
| TPSA | 82.79 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 439.95 |
| LogP ≤ 5 | 4.01 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|