C15H15N3O2 — CID 177138853
4-(methoxymethyl)-6-methyl-9H-pyrido[3,4-b]indole-3-carboxamide (PubChem CID 177138853) has the molecular formula C15H15N3O2 and a molecular weight of 269.30 g/mol. Its IUPAC name is 4-(methoxymethyl)-6-methyl-9H-pyrido[3,4-b]indole-3-carboxamide.
| Compound Name | 4-(methoxymethyl)-6-methyl-9H-pyrido[3,4-b]indole-3-carboxamide |
|---|---|
| PubChem CID | 177138853 |
| Molecular Formula | C15H15N3O2 |
| Molecular Weight | 269.30 g/mol |
| Exact Mass | 269.12 |
| IUPAC Name | 4-(methoxymethyl)-6-methyl-9H-pyrido[3,4-b]indole-3-carboxamide |
| SMILES | COCc1c(C(N)=O)ncc2[nH]c3ccc(C)cc3c12 |
| InChI | InChI=1S/C15H15N3O2/c1-8-3-4-11-9(5-8)13-10(7-20-2)14(15(16)19)17-6-12(13)18-11/h3-6,18H,7H2,1-2H3,(H2,16,19) |
| InChIKey | PALFMNMLXZTVGY-UHFFFAOYSA-N |
| XLogP | 2.27 |
| TPSA | 81.00 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 269.30 |
| LogP ≤ 5 | 2.27 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |