C17H15N2O4PS — CID 177139035
2-[(6-methoxy-2-methyl-1,3-benzothiazole-7-carbonyl)amino]-6-phosphanylbenzoic acid (PubChem CID 177139035) has the molecular formula C17H15N2O4PS and a molecular weight of 374.36 g/mol. Its IUPAC name is 2-[(6-methoxy-2-methyl-1,3-benzothiazole-7-carbonyl)amino]-6-phosphanylbenzoic acid.
| Compound Name | 2-[(6-methoxy-2-methyl-1,3-benzothiazole-7-carbonyl)amino]-6-phosphanylbenzoic acid |
|---|---|
| PubChem CID | 177139035 |
| Molecular Formula | C17H15N2O4PS |
| Molecular Weight | 374.36 g/mol |
| Exact Mass | 374.05 |
| IUPAC Name | 2-[(6-methoxy-2-methyl-1,3-benzothiazole-7-carbonyl)amino]-6-phosphanylbenzoic acid |
| SMILES | COc1ccc2nc(C)sc2c1C(=O)Nc1cccc(P)c1C(=O)O |
| InChI | InChI=1S/C17H15N2O4PS/c1-8-18-10-6-7-11(23-2)14(15(10)25-8)16(20)19-9-4-3-5-12(24)13(9)17(21)22/h3-7H,24H2,1-2H3,(H,19,20)(H,21,22) |
| InChIKey | QRVKDMVSXZNBFP-UHFFFAOYSA-N |
| XLogP | 3.06 |
| TPSA | 88.52 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 374.36 |
| LogP ≤ 5 | 3.06 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|