About 1-ethyl-2-(methoxymethyl)-1,5-dimethylcyclopentane
1-ethyl-2-(methoxymethyl)-1,5-dimethylcyclopentane (PubChem CID 177139058) has the molecular formula C11H22O
and a molecular weight of 170.30 g/mol. Its IUPAC name is 1-ethyl-2-(methoxymethyl)-1,5-dimethylcyclopentane.
Molecular Properties
| Compound Name | 1-ethyl-2-(methoxymethyl)-1,5-dimethylcyclopentane |
| PubChem CID | 177139058 |
| Molecular Formula | C11H22O |
| Molecular Weight | 170.30 g/mol |
| Exact Mass | 170.17 |
| IUPAC Name | 1-ethyl-2-(methoxymethyl)-1,5-dimethylcyclopentane |
| SMILES | CCC1(C)C(C)CCC1COC |
| InChI | InChI=1S/C11H22O/c1-5-11(3)9(2)6-7-10(11)8-12-4/h9-10H,5-8H2,1-4H3 |
| InChIKey | GZFHGNWUAYWEQX-UHFFFAOYSA-N |
| XLogP | 3.10 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 170.30 |
| LogP ≤ 5 | 3.10 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Analyze 1-ethyl-2-(methoxymethyl)-1,5-dimethylcyclopentane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-ethyl-2-(methoxymethyl)-1,5-dimethylcyclopentane?
The IUPAC name of 1-ethyl-2-(methoxymethyl)-1,5-dimethylcyclopentane (CID 177139058) is 1-ethyl-2-(methoxymethyl)-1,5-dimethylcyclopentane.
What is the SMILES notation for 1-ethyl-2-(methoxymethyl)-1,5-dimethylcyclopentane?
The canonical SMILES for 1-ethyl-2-(methoxymethyl)-1,5-dimethylcyclopentane is CCC1(C)C(C)CCC1COC.
What is the InChIKey of 1-ethyl-2-(methoxymethyl)-1,5-dimethylcyclopentane?
The InChIKey is GZFHGNWUAYWEQX-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H22O/c1-5-11(3)9(2)6-7-10(11)8-12-4/h9-10H,5-8H2,1-4H3.
What are the key properties of 1-ethyl-2-(methoxymethyl)-1,5-dimethylcyclopentane?
1-ethyl-2-(methoxymethyl)-1,5-dimethylcyclopentane has a molecular weight of 170.30 g/mol, XLogP of 3.10, 3 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 1-ethyl-2-(methoxymethyl)-1,5-dimethylcyclopentane is sourced from PubChem (CID 177139058), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).