C25H35F3N4O2 — CID 177139737
3-(methylamino)-N-[(2E,4E,6E)-5-methyl-4-[2-oxo-6-[2-(trifluoromethyl)piperidin-1-yl]-1H-pyridin-4-yl]nona-2,4,6-trien-2-yl]propanamide (PubChem CID 177139737) has the molecular formula C25H35F3N4O2 and a molecular weight of 480.58 g/mol. Its IUPAC name is 3-(methylamino)-N-[(2E,4E,6E)-5-methyl-4-[2-oxo-6-[2-(trifluoromethyl)piperidin-1-yl]-1H-pyridin-4-yl]nona-2,4,6-trien-2-yl]propanamide.
| Compound Name | 3-(methylamino)-N-[(2E,4E,6E)-5-methyl-4-[2-oxo-6-[2-(trifluoromethyl)piperidin-1-yl]-1H-pyridin-4-yl]nona-2,4,6-trien-2-yl]propanamide |
|---|---|
| PubChem CID | 177139737 |
| Molecular Formula | C25H35F3N4O2 |
| Molecular Weight | 480.58 g/mol |
| Exact Mass | 480.27 |
| IUPAC Name | 3-(methylamino)-N-[(2E,4E,6E)-5-methyl-4-[2-oxo-6-[2-(trifluoromethyl)piperidin-1-yl]-1H-pyridin-4-yl]nona-2,4,6-trien-2-yl]propanamide |
| SMILES | CC/C=C/C(C)=C(\C=C(/C)NC(=O)CCNC)c1cc(N2CCCCC2C(F)(F)F)[nH]c(=O)c1 |
| InChI | InChI=1S/C25H35F3N4O2/c1-5-6-9-17(2)20(14-18(3)30-23(33)11-12-29-4)19-15-22(31-24(34)16-19)32-13-8-7-10-21(32)25(26,27)28/h6,9,14-16,21,29H,5,7-8,10-13H2,1-4H3,(H,30,33)(H,31,34)/b9-6+,18-14+,20-17+ |
| InChIKey | ATFPJZVPKWFSOU-MEBBZVQISA-N |
| XLogP | 4.67 |
| TPSA | 77.23 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 480.58 |
| LogP ≤ 5 | 4.67 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|