About methyl formate;4-[5-methyl-2-(methylamino)-4-pyridinyl]-6-(2-methylpiperazin-1-yl)-1H-pyridin-2-one
methyl formate;4-[5-methyl-2-(methylamino)-4-pyridinyl]-6-(2-methylpiperazin-1-yl)-1H-pyridin-2-one (PubChem CID 177139863) has the molecular formula C19H27N5O3
and a molecular weight of 373.46 g/mol. Its IUPAC name is methyl formate;4-[5-methyl-2-(methylamino)-4-pyridinyl]-6-(2-methylpiperazin-1-yl)-1H-pyridin-2-one.
Molecular Properties
| Compound Name | methyl formate;4-[5-methyl-2-(methylamino)-4-pyridinyl]-6-(2-methylpiperazin-1-yl)-1H-pyridin-2-one |
| PubChem CID | 177139863 |
| Molecular Formula | C19H27N5O3 |
| Molecular Weight | 373.46 g/mol |
| Exact Mass | 373.21 |
| IUPAC Name | methyl formate;4-[5-methyl-2-(methylamino)-4-pyridinyl]-6-(2-methylpiperazin-1-yl)-1H-pyridin-2-one |
| SMILES | CNc1cc(-c2cc(N3CCNCC3C)[nH]c(=O)c2)c(C)cn1.COC=O |
| InChI | InChI=1S/C17H23N5O.C2H4O2/c1-11-9-20-15(18-3)8-14(11)13-6-16(21-17(23)7-13)22-5-4-19-10-12(22)2;1-4-2-3/h6-9,12,19H,4-5,10H2,1-3H3,(H,18,20)(H,21,23);2H,1H3 |
| InChIKey | UFXASRSBOLTUIE-UHFFFAOYSA-N |
| XLogP | 1.37 |
| TPSA | 99.35 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 373.46 |
| LogP ≤ 5 | 1.37 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|
Analyze methyl formate;4-[5-methyl-2-(methylamino)-4-pyridinyl]-6-(2-methylpiperazin-1-yl)-1H-pyridin-2-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of methyl formate;4-[5-methyl-2-(methylamino)-4-pyridinyl]-6-(2-methylpiperazin-1-yl)-1H-pyridin-2-one?
The IUPAC name of methyl formate;4-[5-methyl-2-(methylamino)-4-pyridinyl]-6-(2-methylpiperazin-1-yl)-1H-pyridin-2-one (CID 177139863) is methyl formate;4-[5-methyl-2-(methylamino)-4-pyridinyl]-6-(2-methylpiperazin-1-yl)-1H-pyridin-2-one.
What is the SMILES notation for methyl formate;4-[5-methyl-2-(methylamino)-4-pyridinyl]-6-(2-methylpiperazin-1-yl)-1H-pyridin-2-one?
The canonical SMILES for methyl formate;4-[5-methyl-2-(methylamino)-4-pyridinyl]-6-(2-methylpiperazin-1-yl)-1H-pyridin-2-one is CNc1cc(-c2cc(N3CCNCC3C)[nH]c(=O)c2)c(C)cn1.COC=O.
What is the InChIKey of methyl formate;4-[5-methyl-2-(methylamino)-4-pyridinyl]-6-(2-methylpiperazin-1-yl)-1H-pyridin-2-one?
The InChIKey is UFXASRSBOLTUIE-UHFFFAOYSA-N. The full InChI is InChI=1S/C17H23N5O.C2H4O2/c1-11-9-20-15(18-3)8-14(11)13-6-16(21-17(23)7-13)22-5-4-19-10-12(22)2;1-4-2-3/h6-9,12,19H,4-5,10H2,1-3H3,(H,18,20)(H,21,23);2H,1H3.
What are the key properties of methyl formate;4-[5-methyl-2-(methylamino)-4-pyridinyl]-6-(2-methylpiperazin-1-yl)-1H-pyridin-2-one?
methyl formate;4-[5-methyl-2-(methylamino)-4-pyridinyl]-6-(2-methylpiperazin-1-yl)-1H-pyridin-2-one has a molecular weight of 373.46 g/mol, XLogP of 1.37, 4 rotatable bonds, 3 hydrogen bond donors, and 7 hydrogen bond acceptors.
Where does this data come from?
All data for methyl formate;4-[5-methyl-2-(methylamino)-4-pyridinyl]-6-(2-methylpiperazin-1-yl)-1H-pyridin-2-one is sourced from PubChem (CID 177139863), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).