C19H18ClN3O4S — CID 177140147
6-chloro-1-methyl-N-(7-sulfamoyl-3,4-dihydro-2H-chromen-4-yl)indole-2-carboxamide (PubChem CID 177140147) has the molecular formula C19H18ClN3O4S and a molecular weight of 419.89 g/mol. Its IUPAC name is 6-chloro-1-methyl-N-(7-sulfamoyl-3,4-dihydro-2H-chromen-4-yl)indole-2-carboxamide.
| Compound Name | 6-chloro-1-methyl-N-(7-sulfamoyl-3,4-dihydro-2H-chromen-4-yl)indole-2-carboxamide |
|---|---|
| PubChem CID | 177140147 |
| Molecular Formula | C19H18ClN3O4S |
| Molecular Weight | 419.89 g/mol |
| Exact Mass | 419.07 |
| IUPAC Name | 6-chloro-1-methyl-N-(7-sulfamoyl-3,4-dihydro-2H-chromen-4-yl)indole-2-carboxamide |
| SMILES | Cn1c(C(=O)NC2CCOc3cc(S(N)(=O)=O)ccc32)cc2ccc(Cl)cc21 |
| InChI | InChI=1S/C19H18ClN3O4S/c1-23-16-9-12(20)3-2-11(16)8-17(23)19(24)22-15-6-7-27-18-10-13(28(21,25)26)4-5-14(15)18/h2-5,8-10,15H,6-7H2,1H3,(H,22,24)(H2,21,25,26) |
| InChIKey | XDQQFSNQZMBKOV-UHFFFAOYSA-N |
| XLogP | 2.73 |
| TPSA | 103.42 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 419.89 |
| LogP ≤ 5 | 2.73 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |