About 2-(4,5-dimethyl-3,6-dihydro-2H-pyridin-1-yl)acetonitrile;ethane;propane
2-(4,5-dimethyl-3,6-dihydro-2H-pyridin-1-yl)acetonitrile;ethane;propane (PubChem CID 177140859) has the molecular formula C14H28N2
and a molecular weight of 224.39 g/mol. Its IUPAC name is 2-(4,5-dimethyl-3,6-dihydro-2H-pyridin-1-yl)acetonitrile;ethane;propane.
Molecular Properties
| Compound Name | 2-(4,5-dimethyl-3,6-dihydro-2H-pyridin-1-yl)acetonitrile;ethane;propane |
| PubChem CID | 177140859 |
| Molecular Formula | C14H28N2 |
| Molecular Weight | 224.39 g/mol |
| Exact Mass | 224.23 |
| IUPAC Name | 2-(4,5-dimethyl-3,6-dihydro-2H-pyridin-1-yl)acetonitrile;ethane;propane |
| SMILES | CC.CC1=C(C)CN(CC#N)CC1.CCC |
| InChI | InChI=1S/C9H14N2.C3H8.C2H6/c1-8-3-5-11(6-4-10)7-9(8)2;1-3-2;1-2/h3,5-7H2,1-2H3;3H2,1-2H3;1-2H3 |
| InChIKey | XSOLXNGOAMCWKN-UHFFFAOYSA-N |
| XLogP | 3.99 |
| TPSA | 27.03 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 224.39 |
| LogP ≤ 5 | 3.99 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'cyanamide', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|
Analyze 2-(4,5-dimethyl-3,6-dihydro-2H-pyridin-1-yl)acetonitrile;ethane;propane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-(4,5-dimethyl-3,6-dihydro-2H-pyridin-1-yl)acetonitrile;ethane;propane?
The IUPAC name of 2-(4,5-dimethyl-3,6-dihydro-2H-pyridin-1-yl)acetonitrile;ethane;propane (CID 177140859) is 2-(4,5-dimethyl-3,6-dihydro-2H-pyridin-1-yl)acetonitrile;ethane;propane.
What is the SMILES notation for 2-(4,5-dimethyl-3,6-dihydro-2H-pyridin-1-yl)acetonitrile;ethane;propane?
The canonical SMILES for 2-(4,5-dimethyl-3,6-dihydro-2H-pyridin-1-yl)acetonitrile;ethane;propane is CC.CC1=C(C)CN(CC#N)CC1.CCC.
What is the InChIKey of 2-(4,5-dimethyl-3,6-dihydro-2H-pyridin-1-yl)acetonitrile;ethane;propane?
The InChIKey is XSOLXNGOAMCWKN-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H14N2.C3H8.C2H6/c1-8-3-5-11(6-4-10)7-9(8)2;1-3-2;1-2/h3,5-7H2,1-2H3;3H2,1-2H3;1-2H3.
What are the key properties of 2-(4,5-dimethyl-3,6-dihydro-2H-pyridin-1-yl)acetonitrile;ethane;propane?
2-(4,5-dimethyl-3,6-dihydro-2H-pyridin-1-yl)acetonitrile;ethane;propane has a molecular weight of 224.39 g/mol, XLogP of 3.99, 1 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 2-(4,5-dimethyl-3,6-dihydro-2H-pyridin-1-yl)acetonitrile;ethane;propane is sourced from PubChem (CID 177140859), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).