About 2-[(3,4-dimethylcyclohex-3-en-1-yl)-methylamino]acetonitrile;ethane
2-[(3,4-dimethylcyclohex-3-en-1-yl)-methylamino]acetonitrile;ethane (PubChem CID 177140895) has the molecular formula C15H30N2
and a molecular weight of 238.42 g/mol. Its IUPAC name is 2-[(3,4-dimethylcyclohex-3-en-1-yl)-methylamino]acetonitrile;ethane.
Molecular Properties
| Compound Name | 2-[(3,4-dimethylcyclohex-3-en-1-yl)-methylamino]acetonitrile;ethane |
| PubChem CID | 177140895 |
| Molecular Formula | C15H30N2 |
| Molecular Weight | 238.42 g/mol |
| Exact Mass | 238.24 |
| IUPAC Name | 2-[(3,4-dimethylcyclohex-3-en-1-yl)-methylamino]acetonitrile;ethane |
| SMILES | CC.CC.CC1=C(C)CC(N(C)CC#N)CC1 |
| InChI | InChI=1S/C11H18N2.2C2H6/c1-9-4-5-11(8-10(9)2)13(3)7-6-12;2*1-2/h11H,4-5,7-8H2,1-3H3;2*1-2H3 |
| InChIKey | LNPICDPAPNGOOC-UHFFFAOYSA-N |
| XLogP | 4.38 |
| TPSA | 27.03 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 238.42 |
| LogP ≤ 5 | 4.38 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'cyanamide', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|
Analyze 2-[(3,4-dimethylcyclohex-3-en-1-yl)-methylamino]acetonitrile;ethane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-[(3,4-dimethylcyclohex-3-en-1-yl)-methylamino]acetonitrile;ethane?
The IUPAC name of 2-[(3,4-dimethylcyclohex-3-en-1-yl)-methylamino]acetonitrile;ethane (CID 177140895) is 2-[(3,4-dimethylcyclohex-3-en-1-yl)-methylamino]acetonitrile;ethane.
What is the SMILES notation for 2-[(3,4-dimethylcyclohex-3-en-1-yl)-methylamino]acetonitrile;ethane?
The canonical SMILES for 2-[(3,4-dimethylcyclohex-3-en-1-yl)-methylamino]acetonitrile;ethane is CC.CC.CC1=C(C)CC(N(C)CC#N)CC1.
What is the InChIKey of 2-[(3,4-dimethylcyclohex-3-en-1-yl)-methylamino]acetonitrile;ethane?
The InChIKey is LNPICDPAPNGOOC-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H18N2.2C2H6/c1-9-4-5-11(8-10(9)2)13(3)7-6-12;2*1-2/h11H,4-5,7-8H2,1-3H3;2*1-2H3.
What are the key properties of 2-[(3,4-dimethylcyclohex-3-en-1-yl)-methylamino]acetonitrile;ethane?
2-[(3,4-dimethylcyclohex-3-en-1-yl)-methylamino]acetonitrile;ethane has a molecular weight of 238.42 g/mol, XLogP of 4.38, 2 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 2-[(3,4-dimethylcyclohex-3-en-1-yl)-methylamino]acetonitrile;ethane is sourced from PubChem (CID 177140895), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).