About 3,4-dimethylcyclohex-3-en-1-amine;ethane
3,4-dimethylcyclohex-3-en-1-amine;ethane (PubChem CID 177140946) has the molecular formula C12H27N
and a molecular weight of 185.35 g/mol. Its IUPAC name is 3,4-dimethylcyclohex-3-en-1-amine;ethane.
Molecular Properties
| Compound Name | 3,4-dimethylcyclohex-3-en-1-amine;ethane |
| PubChem CID | 177140946 |
| Molecular Formula | C12H27N |
| Molecular Weight | 185.35 g/mol |
| Exact Mass | 185.21 |
| IUPAC Name | 3,4-dimethylcyclohex-3-en-1-amine;ethane |
| SMILES | CC.CC.CC1=C(C)CC(N)CC1 |
| InChI | InChI=1S/C8H15N.2C2H6/c1-6-3-4-8(9)5-7(6)2;2*1-2/h8H,3-5,9H2,1-2H3;2*1-2H3 |
| InChIKey | HBXUHNLUONQNRQ-UHFFFAOYSA-N |
| XLogP | 3.89 |
| TPSA | 26.02 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 185.35 |
| LogP ≤ 5 | 3.89 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|
Analyze 3,4-dimethylcyclohex-3-en-1-amine;ethane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3,4-dimethylcyclohex-3-en-1-amine;ethane?
The IUPAC name of 3,4-dimethylcyclohex-3-en-1-amine;ethane (CID 177140946) is 3,4-dimethylcyclohex-3-en-1-amine;ethane.
What is the SMILES notation for 3,4-dimethylcyclohex-3-en-1-amine;ethane?
The canonical SMILES for 3,4-dimethylcyclohex-3-en-1-amine;ethane is CC.CC.CC1=C(C)CC(N)CC1.
What is the InChIKey of 3,4-dimethylcyclohex-3-en-1-amine;ethane?
The InChIKey is HBXUHNLUONQNRQ-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H15N.2C2H6/c1-6-3-4-8(9)5-7(6)2;2*1-2/h8H,3-5,9H2,1-2H3;2*1-2H3.
What are the key properties of 3,4-dimethylcyclohex-3-en-1-amine;ethane?
3,4-dimethylcyclohex-3-en-1-amine;ethane has a molecular weight of 185.35 g/mol, XLogP of 3.89, 0 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 3,4-dimethylcyclohex-3-en-1-amine;ethane is sourced from PubChem (CID 177140946), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).