C11H15NO2 — CID 177141152
4-(cyclohexa-1,5-dien-1-ylmethyl)morpholin-3-one (PubChem CID 177141152) has the molecular formula C11H15NO2 and a molecular weight of 193.25 g/mol. Its IUPAC name is 4-(cyclohexa-1,5-dien-1-ylmethyl)morpholin-3-one.
| Compound Name | 4-(cyclohexa-1,5-dien-1-ylmethyl)morpholin-3-one |
|---|---|
| PubChem CID | 177141152 |
| Molecular Formula | C11H15NO2 |
| Molecular Weight | 193.25 g/mol |
| Exact Mass | 193.11 |
| IUPAC Name | 4-(cyclohexa-1,5-dien-1-ylmethyl)morpholin-3-one |
| SMILES | O=C1COCCN1CC1=CCCC=C1 |
| InChI | InChI=1S/C11H15NO2/c13-11-9-14-7-6-12(11)8-10-4-2-1-3-5-10/h2,4-5H,1,3,6-9H2 |
| InChIKey | NLCBHYCEVJPLCI-UHFFFAOYSA-N |
| XLogP | 1.12 |
| TPSA | 29.54 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 193.25 |
| LogP ≤ 5 | 1.12 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |