C16H25NO2 — CID 177141881
N-(2,4-dimethylpentan-3-yl)-3-(4-hydroxyphenyl)propanamide (PubChem CID 177141881) has the molecular formula C16H25NO2 and a molecular weight of 263.38 g/mol. Its IUPAC name is N-(2,4-dimethylpentan-3-yl)-3-(4-hydroxyphenyl)propanamide.
| Compound Name | N-(2,4-dimethylpentan-3-yl)-3-(4-hydroxyphenyl)propanamide |
|---|---|
| PubChem CID | 177141881 |
| Molecular Formula | C16H25NO2 |
| Molecular Weight | 263.38 g/mol |
| Exact Mass | 263.19 |
| IUPAC Name | N-(2,4-dimethylpentan-3-yl)-3-(4-hydroxyphenyl)propanamide |
| SMILES | CC(C)C(NC(=O)CCc1ccc(O)cc1)C(C)C |
| InChI | InChI=1S/C16H25NO2/c1-11(2)16(12(3)4)17-15(19)10-7-13-5-8-14(18)9-6-13/h5-6,8-9,11-12,16,18H,7,10H2,1-4H3,(H,17,19) |
| InChIKey | YNYXGVOXVRCZCN-UHFFFAOYSA-N |
| XLogP | 3.12 |
| TPSA | 49.33 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 263.38 |
| LogP ≤ 5 | 3.12 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |