C17H21NO2 — CID 177141992
12,17-dimethyl-3-oxa-13-azatetracyclo[11.3.1.02,10.04,9]heptadeca-2(10),4(9),5,7-tetraen-7-ol (PubChem CID 177141992) has the molecular formula C17H21NO2 and a molecular weight of 271.36 g/mol. Its IUPAC name is 12,17-dimethyl-3-oxa-13-azatetracyclo[11.3.1.02,10.04,9]heptadeca-2(10),4(9),5,7-tetraen-7-ol.
| Compound Name | 12,17-dimethyl-3-oxa-13-azatetracyclo[11.3.1.02,10.04,9]heptadeca-2(10),4(9),5,7-tetraen-7-ol |
|---|---|
| PubChem CID | 177141992 |
| Molecular Formula | C17H21NO2 |
| Molecular Weight | 271.36 g/mol |
| Exact Mass | 271.16 |
| IUPAC Name | 12,17-dimethyl-3-oxa-13-azatetracyclo[11.3.1.02,10.04,9]heptadeca-2(10),4(9),5,7-tetraen-7-ol |
| SMILES | CC1Cc2c(oc3ccc(O)cc23)C2CCCN1C2C |
| InChI | InChI=1S/C17H21NO2/c1-10-8-15-14-9-12(19)5-6-16(14)20-17(15)13-4-3-7-18(10)11(13)2/h5-6,9-11,13,19H,3-4,7-8H2,1-2H3 |
| InChIKey | IIAVZRJAMANVOZ-UHFFFAOYSA-N |
| XLogP | 3.65 |
| TPSA | 36.61 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 271.36 |
| LogP ≤ 5 | 3.65 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |