C32H34BFN2O — CID 177143271
CID 177143271 (PubChem CID 177143271) has the molecular formula C32H34BFN2O and a molecular weight of 492.45 g/mol.
| Compound Name | CID 177143271 |
|---|---|
| PubChem CID | 177143271 |
| Molecular Formula | C32H34BFN2O |
| Molecular Weight | 492.45 g/mol |
| Exact Mass | 492.27 |
| IUPAC Name | — |
| SMILES | [B]/C(=C/C)c1ccc(C(=O)N2CCC(C(=C)N(Cc3cccc(F)c3)c3ccccc3C)CC2)cc1C |
| InChI | InChI=1S/C32H34BFN2O/c1-5-30(33)29-14-13-27(19-23(29)3)32(37)35-17-15-26(16-18-35)24(4)36(31-12-7-6-9-22(31)2)21-25-10-8-11-28(34)20-25/h5-14,19-20,26H,4,15-18,21H2,1-3H3/b30-5+ |
| InChIKey | IJLDBCGLDMBUHU-NZRVNVCISA-N |
| XLogP | 7.04 |
| TPSA | 23.55 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 492.45 |
| LogP ≤ 5 | 7.04 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|