C26H31NO2 — CID 177144212
N,3a-dimethyl-6-oxo-N-phenyl-1-propan-2-yl-2,3,4,5,5a,7-hexahydrocyclohepta[e]indene-8-carboxamide (PubChem CID 177144212) has the molecular formula C26H31NO2 and a molecular weight of 389.54 g/mol. Its IUPAC name is N,3a-dimethyl-6-oxo-N-phenyl-1-propan-2-yl-2,3,4,5,5a,7-hexahydrocyclohepta[e]indene-8-carboxamide.
| Compound Name | N,3a-dimethyl-6-oxo-N-phenyl-1-propan-2-yl-2,3,4,5,5a,7-hexahydrocyclohepta[e]indene-8-carboxamide |
|---|---|
| PubChem CID | 177144212 |
| Molecular Formula | C26H31NO2 |
| Molecular Weight | 389.54 g/mol |
| Exact Mass | 389.24 |
| IUPAC Name | N,3a-dimethyl-6-oxo-N-phenyl-1-propan-2-yl-2,3,4,5,5a,7-hexahydrocyclohepta[e]indene-8-carboxamide |
| SMILES | CC(C)C1=C2C3=CC=C(C(=O)N(C)c4ccccc4)CC(=O)C3CCC2(C)CC1 |
| InChI | InChI=1S/C26H31NO2/c1-17(2)20-12-14-26(3)15-13-21-22(24(20)26)11-10-18(16-23(21)28)25(29)27(4)19-8-6-5-7-9-19/h5-11,17,21H,12-16H2,1-4H3 |
| InChIKey | HWNAOMHTULQEBJ-UHFFFAOYSA-N |
| XLogP | 5.64 |
| TPSA | 37.38 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 389.54 |
| LogP ≤ 5 | 5.64 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |