C30H41NO7S — CID 177144255
N-[(3aR,5aR,6S)-3a,5a-dimethyl-1-propan-2-yl-6-[(2S,3R,4S,5R)-3,4,5-trihydroxyoxan-2-yl]oxy-2,3,4,5,6,7-hexahydrocyclohepta[e]inden-8-yl]benzenesulfonamide (PubChem CID 177144255) has the molecular formula C30H41NO7S and a molecular weight of 559.73 g/mol. Its IUPAC name is N-[(3aR,5aR,6S)-3a,5a-dimethyl-1-propan-2-yl-6-[(2S,3R,4S,5R)-3,4,5-trihydroxyoxan-2-yl]oxy-2,3,4,5,6,7-hexahydrocyclohepta[e]inden-8-yl]benzenesulfonamide.
| Compound Name | N-[(3aR,5aR,6S)-3a,5a-dimethyl-1-propan-2-yl-6-[(2S,3R,4S,5R)-3,4,5-trihydroxyoxan-2-yl]oxy-2,3,4,5,6,7-hexahydrocyclohepta[e]inden-8-yl]benzenesulfonamide |
|---|---|
| PubChem CID | 177144255 |
| Molecular Formula | C30H41NO7S |
| Molecular Weight | 559.73 g/mol |
| Exact Mass | 559.26 |
| IUPAC Name | N-[(3aR,5aR,6S)-3a,5a-dimethyl-1-propan-2-yl-6-[(2S,3R,4S,5R)-3,4,5-trihydroxyoxan-2-yl]oxy-2,3,4,5,6,7-hexahydrocyclohepta[e]inden-8-yl]benzenesulfonamide |
| SMILES | CC(C)C1=C2C3=CC=C(NS(=O)(=O)c4ccccc4)C[C@H](O[C@@H]4OC[C@@H](O)[C@H](O)[C@H]4O)[C@]3(C)CC[C@@]2(C)CC1 |
| InChI | InChI=1S/C30H41NO7S/c1-18(2)21-12-13-29(3)14-15-30(4)22(25(21)29)11-10-19(31-39(35,36)20-8-6-5-7-9-20)16-24(30)38-28-27(34)26(33)23(32)17-37-28/h5-11,18,23-24,26-28,31-34H,12-17H2,1-4H3/t23-,24+,26+,27-,28+,29-,30-/m1/s1 |
| InChIKey | YPFFCVPNDLNECP-IDCRBEQPSA-N |
| XLogP | 3.56 |
| TPSA | 125.32 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 39 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 559.73 |
| LogP ≤ 5 | 3.56 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 7 |