C31H40O6 — CID 177144275
[(3aR,5aR,6S)-3a,5a-dimethyl-1-propan-2-yl-6-[(2S,3R,4S,5R)-3,4,5-trihydroxyoxan-2-yl]oxy-2,3,4,5,6,7-hexahydrocyclohepta[e]inden-8-yl]-phenylmethanone (PubChem CID 177144275) has the molecular formula C31H40O6 and a molecular weight of 508.66 g/mol. Its IUPAC name is [(3aR,5aR,6S)-3a,5a-dimethyl-1-propan-2-yl-6-[(2S,3R,4S,5R)-3,4,5-trihydroxyoxan-2-yl]oxy-2,3,4,5,6,7-hexahydrocyclohepta[e]inden-8-yl]-phenylmethanone.
| Compound Name | [(3aR,5aR,6S)-3a,5a-dimethyl-1-propan-2-yl-6-[(2S,3R,4S,5R)-3,4,5-trihydroxyoxan-2-yl]oxy-2,3,4,5,6,7-hexahydrocyclohepta[e]inden-8-yl]-phenylmethanone |
|---|---|
| PubChem CID | 177144275 |
| Molecular Formula | C31H40O6 |
| Molecular Weight | 508.66 g/mol |
| Exact Mass | 508.28 |
| IUPAC Name | [(3aR,5aR,6S)-3a,5a-dimethyl-1-propan-2-yl-6-[(2S,3R,4S,5R)-3,4,5-trihydroxyoxan-2-yl]oxy-2,3,4,5,6,7-hexahydrocyclohepta[e]inden-8-yl]-phenylmethanone |
| SMILES | CC(C)C1=C2C3=CC=C(C(=O)c4ccccc4)C[C@H](O[C@@H]4OC[C@@H](O)[C@H](O)[C@H]4O)[C@]3(C)CC[C@@]2(C)CC1 |
| InChI | InChI=1S/C31H40O6/c1-18(2)21-12-13-30(3)14-15-31(4)22(25(21)30)11-10-20(26(33)19-8-6-5-7-9-19)16-24(31)37-29-28(35)27(34)23(32)17-36-29/h5-11,18,23-24,27-29,32,34-35H,12-17H2,1-4H3/t23-,24+,27+,28-,29+,30-,31-/m1/s1 |
| InChIKey | NJZBEUZGTGPRSX-VLKYSQLYSA-N |
| XLogP | 4.50 |
| TPSA | 96.22 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 508.66 |
| LogP ≤ 5 | 4.50 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |