C22H32N2O2 — CID 177144307
N-[(6-hydroxy-3a-methyl-1-propan-2-yl-3,4,5,5a,6,7-hexahydro-2H-cyclohepta[e]inden-8-yl)methyl]aziridine-2-carboxamide (PubChem CID 177144307) has the molecular formula C22H32N2O2 and a molecular weight of 356.51 g/mol. Its IUPAC name is N-[(6-hydroxy-3a-methyl-1-propan-2-yl-3,4,5,5a,6,7-hexahydro-2H-cyclohepta[e]inden-8-yl)methyl]aziridine-2-carboxamide.
| Compound Name | N-[(6-hydroxy-3a-methyl-1-propan-2-yl-3,4,5,5a,6,7-hexahydro-2H-cyclohepta[e]inden-8-yl)methyl]aziridine-2-carboxamide |
|---|---|
| PubChem CID | 177144307 |
| Molecular Formula | C22H32N2O2 |
| Molecular Weight | 356.51 g/mol |
| Exact Mass | 356.25 |
| IUPAC Name | N-[(6-hydroxy-3a-methyl-1-propan-2-yl-3,4,5,5a,6,7-hexahydro-2H-cyclohepta[e]inden-8-yl)methyl]aziridine-2-carboxamide |
| SMILES | CC(C)C1=C2C3=CC=C(CNC(=O)C4CN4)CC(O)C3CCC2(C)CC1 |
| InChI | InChI=1S/C22H32N2O2/c1-13(2)15-6-8-22(3)9-7-16-17(20(15)22)5-4-14(10-19(16)25)11-24-21(26)18-12-23-18/h4-5,13,16,18-19,23,25H,6-12H2,1-3H3,(H,24,26) |
| InChIKey | VIMBBMGXEUTQGQ-UHFFFAOYSA-N |
| XLogP | 2.85 |
| TPSA | 71.27 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 356.51 |
| LogP ≤ 5 | 2.85 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|