C23H31FN6O4 — CID 177144497
tert-butyl (4S)-2-(4-fluoro-3,5-dimethylphenyl)-3-[(2-methoxycarbonylhydrazinyl)methylideneamino]-4-methyl-6,7-dihydro-4H-pyrazolo[4,3-c]pyridine-5-carboxylate (PubChem CID 177144497) has the molecular formula C23H31FN6O4 and a molecular weight of 474.54 g/mol. Its IUPAC name is tert-butyl (4S)-2-(4-fluoro-3,5-dimethylphenyl)-3-[(2-methoxycarbonylhydrazinyl)methylideneamino]-4-methyl-6,7-dihydro-4H-pyrazolo[4,3-c]pyridine-5-carboxylate.
| Compound Name | tert-butyl (4S)-2-(4-fluoro-3,5-dimethylphenyl)-3-[(2-methoxycarbonylhydrazinyl)methylideneamino]-4-methyl-6,7-dihydro-4H-pyrazolo[4,3-c]pyridine-5-carboxylate |
|---|---|
| PubChem CID | 177144497 |
| Molecular Formula | C23H31FN6O4 |
| Molecular Weight | 474.54 g/mol |
| Exact Mass | 474.24 |
| IUPAC Name | tert-butyl (4S)-2-(4-fluoro-3,5-dimethylphenyl)-3-[(2-methoxycarbonylhydrazinyl)methylideneamino]-4-methyl-6,7-dihydro-4H-pyrazolo[4,3-c]pyridine-5-carboxylate |
| SMILES | COC(=O)NNC=Nc1c2c(nn1-c1cc(C)c(F)c(C)c1)CCN(C(=O)OC(C)(C)C)[C@H]2C |
| InChI | InChI=1S/C23H31FN6O4/c1-13-10-16(11-14(2)19(13)24)30-20(25-12-26-27-21(31)33-7)18-15(3)29(9-8-17(18)28-30)22(32)34-23(4,5)6/h10-12,15H,8-9H2,1-7H3,(H,25,26)(H,27,31)/t15-/m0/s1 |
| InChIKey | SRPSZDQCUGQIRX-HNNXBMFYSA-N |
| XLogP | 4.00 |
| TPSA | 110.08 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 474.54 |
| LogP ≤ 5 | 4.00 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|