C40H31N3O2S — CID 177145058
3,3,4,4-tetramethyl-1-[16-[3-(4-phenylphenyl)phenyl]-11-thia-13,15-diazatetracyclo[8.7.0.02,7.012,17]heptadeca-1(10),2,4,6,8,12,14,16-octaen-14-yl]pyrrolidine-2,5-dione (PubChem CID 177145058) has the molecular formula C40H31N3O2S and a molecular weight of 617.77 g/mol. Its IUPAC name is 3,3,4,4-tetramethyl-1-[16-[3-(4-phenylphenyl)phenyl]-11-thia-13,15-diazatetracyclo[8.7.0.02,7.012,17]heptadeca-1(10),2,4,6,8,12,14,16-octaen-14-yl]pyrrolidine-2,5-dione.
| Compound Name | 3,3,4,4-tetramethyl-1-[16-[3-(4-phenylphenyl)phenyl]-11-thia-13,15-diazatetracyclo[8.7.0.02,7.012,17]heptadeca-1(10),2,4,6,8,12,14,16-octaen-14-yl]pyrrolidine-2,5-dione |
|---|---|
| PubChem CID | 177145058 |
| Molecular Formula | C40H31N3O2S |
| Molecular Weight | 617.77 g/mol |
| Exact Mass | 617.21 |
| IUPAC Name | 3,3,4,4-tetramethyl-1-[16-[3-(4-phenylphenyl)phenyl]-11-thia-13,15-diazatetracyclo[8.7.0.02,7.012,17]heptadeca-1(10),2,4,6,8,12,14,16-octaen-14-yl]pyrrolidine-2,5-dione |
| SMILES | CC1(C)C(=O)N(c2nc(-c3cccc(-c4ccc(-c5ccccc5)cc4)c3)c3c(n2)sc2ccc4ccccc4c23)C(=O)C1(C)C |
| InChI | InChI=1S/C40H31N3O2S/c1-39(2)36(44)43(37(45)40(39,3)4)38-41-34(33-32-30-16-9-8-13-27(30)21-22-31(32)46-35(33)42-38)29-15-10-14-28(23-29)26-19-17-25(18-20-26)24-11-6-5-7-12-24/h5-23H,1-4H3 |
| InChIKey | NUCHXKCKXYAEPA-UHFFFAOYSA-N |
| XLogP | 9.92 |
| TPSA | 63.16 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 46 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 617.77 |
| LogP ≤ 5 | 9.92 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|