About (4,4-difluorocyclohexyl) N-(5-hydroxypentyl)carbamate
(4,4-difluorocyclohexyl) N-(5-hydroxypentyl)carbamate (PubChem CID 177145475) has the molecular formula C12H21F2NO3
and a molecular weight of 265.30 g/mol. Its IUPAC name is (4,4-difluorocyclohexyl) N-(5-hydroxypentyl)carbamate.
Molecular Properties
| Compound Name | (4,4-difluorocyclohexyl) N-(5-hydroxypentyl)carbamate |
| PubChem CID | 177145475 |
| Molecular Formula | C12H21F2NO3 |
| Molecular Weight | 265.30 g/mol |
| Exact Mass | 265.15 |
| IUPAC Name | (4,4-difluorocyclohexyl) N-(5-hydroxypentyl)carbamate |
| SMILES | O=C(NCCCCCO)OC1CCC(F)(F)CC1 |
| InChI | InChI=1S/C12H21F2NO3/c13-12(14)6-4-10(5-7-12)18-11(17)15-8-2-1-3-9-16/h10,16H,1-9H2,(H,15,17) |
| InChIKey | NKACBLLQSAMQQG-UHFFFAOYSA-N |
| XLogP | 2.45 |
| TPSA | 58.56 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 265.30 |
| LogP ≤ 5 | 2.45 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze (4,4-difluorocyclohexyl) N-(5-hydroxypentyl)carbamate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (4,4-difluorocyclohexyl) N-(5-hydroxypentyl)carbamate?
The IUPAC name of (4,4-difluorocyclohexyl) N-(5-hydroxypentyl)carbamate (CID 177145475) is (4,4-difluorocyclohexyl) N-(5-hydroxypentyl)carbamate.
What is the SMILES notation for (4,4-difluorocyclohexyl) N-(5-hydroxypentyl)carbamate?
The canonical SMILES for (4,4-difluorocyclohexyl) N-(5-hydroxypentyl)carbamate is O=C(NCCCCCO)OC1CCC(F)(F)CC1.
What is the InChIKey of (4,4-difluorocyclohexyl) N-(5-hydroxypentyl)carbamate?
The InChIKey is NKACBLLQSAMQQG-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H21F2NO3/c13-12(14)6-4-10(5-7-12)18-11(17)15-8-2-1-3-9-16/h10,16H,1-9H2,(H,15,17).
What are the key properties of (4,4-difluorocyclohexyl) N-(5-hydroxypentyl)carbamate?
(4,4-difluorocyclohexyl) N-(5-hydroxypentyl)carbamate has a molecular weight of 265.30 g/mol, XLogP of 2.45, 6 rotatable bonds, 2 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for (4,4-difluorocyclohexyl) N-(5-hydroxypentyl)carbamate is sourced from PubChem (CID 177145475), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).