C16H18F2N2O — CID 177146065
3-fluoro-2-[(7-fluoroquinolin-6-yl)methylamino]cyclohexan-1-ol (PubChem CID 177146065) has the molecular formula C16H18F2N2O and a molecular weight of 292.33 g/mol. Its IUPAC name is 3-fluoro-2-[(7-fluoroquinolin-6-yl)methylamino]cyclohexan-1-ol.
| Compound Name | 3-fluoro-2-[(7-fluoroquinolin-6-yl)methylamino]cyclohexan-1-ol |
|---|---|
| PubChem CID | 177146065 |
| Molecular Formula | C16H18F2N2O |
| Molecular Weight | 292.33 g/mol |
| Exact Mass | 292.14 |
| IUPAC Name | 3-fluoro-2-[(7-fluoroquinolin-6-yl)methylamino]cyclohexan-1-ol |
| SMILES | OC1CCCC(F)C1NCc1cc2cccnc2cc1F |
| InChI | InChI=1S/C16H18F2N2O/c17-12-4-1-5-15(21)16(12)20-9-11-7-10-3-2-6-19-14(10)8-13(11)18/h2-3,6-8,12,15-16,20-21H,1,4-5,9H2 |
| InChIKey | ZOKJAJIHUPMJDS-UHFFFAOYSA-N |
| XLogP | 2.71 |
| TPSA | 45.15 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 292.33 |
| LogP ≤ 5 | 2.71 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |