About 3-[(2S)-4,4-difluorohexan-2-yl]-N,2-dimethylaniline
3-[(2S)-4,4-difluorohexan-2-yl]-N,2-dimethylaniline (PubChem CID 177146471) has the molecular formula C14H21F2N
and a molecular weight of 241.32 g/mol. Its IUPAC name is 3-[(2S)-4,4-difluorohexan-2-yl]-N,2-dimethylaniline.
Molecular Properties
| Compound Name | 3-[(2S)-4,4-difluorohexan-2-yl]-N,2-dimethylaniline |
| PubChem CID | 177146471 |
| Molecular Formula | C14H21F2N |
| Molecular Weight | 241.32 g/mol |
| Exact Mass | 241.16 |
| IUPAC Name | 3-[(2S)-4,4-difluorohexan-2-yl]-N,2-dimethylaniline |
| SMILES | CCC(F)(F)C[C@H](C)c1cccc(NC)c1C |
| InChI | InChI=1S/C14H21F2N/c1-5-14(15,16)9-10(2)12-7-6-8-13(17-4)11(12)3/h6-8,10,17H,5,9H2,1-4H3/t10-/m0/s1 |
| InChIKey | OUQKLBLGBHNWGU-JTQLQIEISA-N |
| XLogP | 4.58 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 241.32 |
| LogP ≤ 5 | 4.58 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
Analyze 3-[(2S)-4,4-difluorohexan-2-yl]-N,2-dimethylaniline with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-[(2S)-4,4-difluorohexan-2-yl]-N,2-dimethylaniline?
The IUPAC name of 3-[(2S)-4,4-difluorohexan-2-yl]-N,2-dimethylaniline (CID 177146471) is 3-[(2S)-4,4-difluorohexan-2-yl]-N,2-dimethylaniline.
What is the SMILES notation for 3-[(2S)-4,4-difluorohexan-2-yl]-N,2-dimethylaniline?
The canonical SMILES for 3-[(2S)-4,4-difluorohexan-2-yl]-N,2-dimethylaniline is CCC(F)(F)C[C@H](C)c1cccc(NC)c1C.
What is the InChIKey of 3-[(2S)-4,4-difluorohexan-2-yl]-N,2-dimethylaniline?
The InChIKey is OUQKLBLGBHNWGU-JTQLQIEISA-N. The full InChI is InChI=1S/C14H21F2N/c1-5-14(15,16)9-10(2)12-7-6-8-13(17-4)11(12)3/h6-8,10,17H,5,9H2,1-4H3/t10-/m0/s1.
What are the key properties of 3-[(2S)-4,4-difluorohexan-2-yl]-N,2-dimethylaniline?
3-[(2S)-4,4-difluorohexan-2-yl]-N,2-dimethylaniline has a molecular weight of 241.32 g/mol, XLogP of 4.58, 5 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 3-[(2S)-4,4-difluorohexan-2-yl]-N,2-dimethylaniline is sourced from PubChem (CID 177146471), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).