C13H20F3N — CID 177148486
(1S,5R)-6-(2-methylprop-2-enyl)-3-(4,4,4-trifluorobutyl)-3-azabicyclo[3.1.0]hexane (PubChem CID 177148486) has the molecular formula C13H20F3N and a molecular weight of 247.30 g/mol. Its IUPAC name is (1S,5R)-6-(2-methylprop-2-enyl)-3-(4,4,4-trifluorobutyl)-3-azabicyclo[3.1.0]hexane.
| Compound Name | (1S,5R)-6-(2-methylprop-2-enyl)-3-(4,4,4-trifluorobutyl)-3-azabicyclo[3.1.0]hexane |
|---|---|
| PubChem CID | 177148486 |
| Molecular Formula | C13H20F3N |
| Molecular Weight | 247.30 g/mol |
| Exact Mass | 247.15 |
| IUPAC Name | (1S,5R)-6-(2-methylprop-2-enyl)-3-(4,4,4-trifluorobutyl)-3-azabicyclo[3.1.0]hexane |
| SMILES | C=C(C)CC1[C@H]2CN(CCCC(F)(F)F)C[C@@H]12 |
| InChI | InChI=1S/C13H20F3N/c1-9(2)6-10-11-7-17(8-12(10)11)5-3-4-13(14,15)16/h10-12H,1,3-8H2,2H3/t10?,11-,12+ |
| InChIKey | QYMZFLKBBRAAMC-YOGCLGLASA-N |
| XLogP | 3.47 |
| TPSA | 3.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 247.30 |
| LogP ≤ 5 | 3.47 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|