C32H45N7OS — CID 177148864
2-(4-hexylpiperazin-1-yl)-1-[4-[2-(6-pyrrolidin-1-yl-3-pyridinyl)-1,3-benzothiazol-6-yl]piperazin-1-yl]ethanone (PubChem CID 177148864) has the molecular formula C32H45N7OS and a molecular weight of 575.83 g/mol. Its IUPAC name is 2-(4-hexylpiperazin-1-yl)-1-[4-[2-(6-pyrrolidin-1-yl-3-pyridinyl)-1,3-benzothiazol-6-yl]piperazin-1-yl]ethanone.
| Compound Name | 2-(4-hexylpiperazin-1-yl)-1-[4-[2-(6-pyrrolidin-1-yl-3-pyridinyl)-1,3-benzothiazol-6-yl]piperazin-1-yl]ethanone |
|---|---|
| PubChem CID | 177148864 |
| Molecular Formula | C32H45N7OS |
| Molecular Weight | 575.83 g/mol |
| Exact Mass | 575.34 |
| IUPAC Name | 2-(4-hexylpiperazin-1-yl)-1-[4-[2-(6-pyrrolidin-1-yl-3-pyridinyl)-1,3-benzothiazol-6-yl]piperazin-1-yl]ethanone |
| SMILES | CCCCCCN1CCN(CC(=O)N2CCN(c3ccc4nc(-c5ccc(N6CCCC6)nc5)sc4c3)CC2)CC1 |
| InChI | InChI=1S/C32H45N7OS/c1-2-3-4-5-12-35-15-17-36(18-16-35)25-31(40)39-21-19-37(20-22-39)27-9-10-28-29(23-27)41-32(34-28)26-8-11-30(33-24-26)38-13-6-7-14-38/h8-11,23-24H,2-7,12-22,25H2,1H3 |
| InChIKey | OTAGOKFKDZKIJO-UHFFFAOYSA-N |
| XLogP | 4.80 |
| TPSA | 59.05 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 41 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 575.83 |
| LogP ≤ 5 | 4.80 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|