About 2-methyl-2-azaspiro[3.4]octane;3-methyl-3,9-diazaspiro[5.5]undecane
2-methyl-2-azaspiro[3.4]octane;3-methyl-3,9-diazaspiro[5.5]undecane (PubChem CID 177149163) has the molecular formula C18H35N3
and a molecular weight of 293.50 g/mol. Its IUPAC name is 2-methyl-2-azaspiro[3.4]octane;3-methyl-3,9-diazaspiro[5.5]undecane.
Molecular Properties
| Compound Name | 2-methyl-2-azaspiro[3.4]octane;3-methyl-3,9-diazaspiro[5.5]undecane |
| PubChem CID | 177149163 |
| Molecular Formula | C18H35N3 |
| Molecular Weight | 293.50 g/mol |
| Exact Mass | 293.28 |
| IUPAC Name | 2-methyl-2-azaspiro[3.4]octane;3-methyl-3,9-diazaspiro[5.5]undecane |
| SMILES | CN1CC2(CCCC2)C1.CN1CCC2(CCNCC2)CC1 |
| InChI | InChI=1S/C10H20N2.C8H15N/c1-12-8-4-10(5-9-12)2-6-11-7-3-10;1-9-6-8(7-9)4-2-3-5-8/h11H,2-9H2,1H3;2-7H2,1H3 |
| InChIKey | NBIKKZOCGAAOHN-UHFFFAOYSA-N |
| XLogP | 2.57 |
| TPSA | 18.51 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 21 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 293.50 |
| LogP ≤ 5 | 2.57 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 2-methyl-2-azaspiro[3.4]octane;3-methyl-3,9-diazaspiro[5.5]undecane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-methyl-2-azaspiro[3.4]octane;3-methyl-3,9-diazaspiro[5.5]undecane?
The IUPAC name of 2-methyl-2-azaspiro[3.4]octane;3-methyl-3,9-diazaspiro[5.5]undecane (CID 177149163) is 2-methyl-2-azaspiro[3.4]octane;3-methyl-3,9-diazaspiro[5.5]undecane.
What is the SMILES notation for 2-methyl-2-azaspiro[3.4]octane;3-methyl-3,9-diazaspiro[5.5]undecane?
The canonical SMILES for 2-methyl-2-azaspiro[3.4]octane;3-methyl-3,9-diazaspiro[5.5]undecane is CN1CC2(CCCC2)C1.CN1CCC2(CCNCC2)CC1.
What is the InChIKey of 2-methyl-2-azaspiro[3.4]octane;3-methyl-3,9-diazaspiro[5.5]undecane?
The InChIKey is NBIKKZOCGAAOHN-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H20N2.C8H15N/c1-12-8-4-10(5-9-12)2-6-11-7-3-10;1-9-6-8(7-9)4-2-3-5-8/h11H,2-9H2,1H3;2-7H2,1H3.
What are the key properties of 2-methyl-2-azaspiro[3.4]octane;3-methyl-3,9-diazaspiro[5.5]undecane?
2-methyl-2-azaspiro[3.4]octane;3-methyl-3,9-diazaspiro[5.5]undecane has a molecular weight of 293.50 g/mol, XLogP of 2.57, 0 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 2-methyl-2-azaspiro[3.4]octane;3-methyl-3,9-diazaspiro[5.5]undecane is sourced from PubChem (CID 177149163), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).