C11H12F2N2O4 — CID 177149367
methyl 4-(2,2-difluoroethylamino)-2-methyl-3-nitrobenzoate (PubChem CID 177149367) has the molecular formula C11H12F2N2O4 and a molecular weight of 274.22 g/mol. Its IUPAC name is methyl 4-(2,2-difluoroethylamino)-2-methyl-3-nitrobenzoate.
| Compound Name | methyl 4-(2,2-difluoroethylamino)-2-methyl-3-nitrobenzoate |
|---|---|
| PubChem CID | 177149367 |
| Molecular Formula | C11H12F2N2O4 |
| Molecular Weight | 274.22 g/mol |
| Exact Mass | 274.08 |
| IUPAC Name | methyl 4-(2,2-difluoroethylamino)-2-methyl-3-nitrobenzoate |
| SMILES | COC(=O)c1ccc(NCC(F)F)c([N+](=O)[O-])c1C |
| InChI | InChI=1S/C11H12F2N2O4/c1-6-7(11(16)19-2)3-4-8(10(6)15(17)18)14-5-9(12)13/h3-4,9,14H,5H2,1-2H3 |
| InChIKey | SBLISOIKGGOEQG-UHFFFAOYSA-N |
| XLogP | 2.37 |
| TPSA | 81.47 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 274.22 |
| LogP ≤ 5 | 2.37 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|