C26H25ClN2O4S — CID 177149622
N-(azetidin-3-yl)-4-methyl-N-[3-(3-methylphenyl)-2-oxochromen-6-yl]benzenesulfonamide;hydrochloride (PubChem CID 177149622) has the molecular formula C26H25ClN2O4S and a molecular weight of 497.02 g/mol. Its IUPAC name is N-(azetidin-3-yl)-4-methyl-N-[3-(3-methylphenyl)-2-oxochromen-6-yl]benzenesulfonamide;hydrochloride.
| Compound Name | N-(azetidin-3-yl)-4-methyl-N-[3-(3-methylphenyl)-2-oxochromen-6-yl]benzenesulfonamide;hydrochloride |
|---|---|
| PubChem CID | 177149622 |
| Molecular Formula | C26H25ClN2O4S |
| Molecular Weight | 497.02 g/mol |
| Exact Mass | 496.12 |
| IUPAC Name | N-(azetidin-3-yl)-4-methyl-N-[3-(3-methylphenyl)-2-oxochromen-6-yl]benzenesulfonamide;hydrochloride |
| SMILES | Cc1ccc(S(=O)(=O)N(c2ccc3oc(=O)c(-c4cccc(C)c4)cc3c2)C2CNC2)cc1.Cl |
| InChI | InChI=1S/C26H24N2O4S.ClH/c1-17-6-9-23(10-7-17)33(30,31)28(22-15-27-16-22)21-8-11-25-20(13-21)14-24(26(29)32-25)19-5-3-4-18(2)12-19;/h3-14,22,27H,15-16H2,1-2H3;1H |
| InChIKey | IXDXPQXLTYVXHR-UHFFFAOYSA-N |
| XLogP | 4.67 |
| TPSA | 79.62 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 497.02 |
| LogP ≤ 5 | 4.67 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'cumarine', 'substructure': 'N/A'} |
|---|