C11H18F3NO — CID 177149842
ethene;(Z)-2-[(Z)-prop-1-enyl]-3-(trifluoromethoxy)pent-2-en-1-amine (PubChem CID 177149842) has the molecular formula C11H18F3NO and a molecular weight of 237.26 g/mol. Its IUPAC name is ethene;(Z)-2-[(Z)-prop-1-enyl]-3-(trifluoromethoxy)pent-2-en-1-amine.
| Compound Name | ethene;(Z)-2-[(Z)-prop-1-enyl]-3-(trifluoromethoxy)pent-2-en-1-amine |
|---|---|
| PubChem CID | 177149842 |
| Molecular Formula | C11H18F3NO |
| Molecular Weight | 237.26 g/mol |
| Exact Mass | 237.13 |
| IUPAC Name | ethene;(Z)-2-[(Z)-prop-1-enyl]-3-(trifluoromethoxy)pent-2-en-1-amine |
| SMILES | C/C=C\C(CN)=C(/CC)OC(F)(F)F.C=C |
| InChI | InChI=1S/C9H14F3NO.C2H4/c1-3-5-7(6-13)8(4-2)14-9(10,11)12;1-2/h3,5H,4,6,13H2,1-2H3;1-2H2/b5-3-,8-7-; |
| InChIKey | HZJRRDMSXGMDJT-QNBLPONFSA-N |
| XLogP | 3.52 |
| TPSA | 35.25 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 237.26 |
| LogP ≤ 5 | 3.52 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|