About 6-chloro-5-cyclopropyl-2,3-dihydro-1H-indazole;ethane
6-chloro-5-cyclopropyl-2,3-dihydro-1H-indazole;ethane (PubChem CID 177150137) has the molecular formula C12H17ClN2
and a molecular weight of 224.73 g/mol. Its IUPAC name is 6-chloro-5-cyclopropyl-2,3-dihydro-1H-indazole;ethane.
Molecular Properties
| Compound Name | 6-chloro-5-cyclopropyl-2,3-dihydro-1H-indazole;ethane |
| PubChem CID | 177150137 |
| Molecular Formula | C12H17ClN2 |
| Molecular Weight | 224.73 g/mol |
| Exact Mass | 224.11 |
| IUPAC Name | 6-chloro-5-cyclopropyl-2,3-dihydro-1H-indazole;ethane |
| SMILES | CC.Clc1cc2c(cc1C1CC1)CNN2 |
| InChI | InChI=1S/C10H11ClN2.C2H6/c11-9-4-10-7(5-12-13-10)3-8(9)6-1-2-6;1-2/h3-4,6,12-13H,1-2,5H2;1-2H3 |
| InChIKey | FYVWSVDHTBSGKK-UHFFFAOYSA-N |
| XLogP | 3.67 |
| TPSA | 24.06 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 224.73 |
| LogP ≤ 5 | 3.67 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 6-chloro-5-cyclopropyl-2,3-dihydro-1H-indazole;ethane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 6-chloro-5-cyclopropyl-2,3-dihydro-1H-indazole;ethane?
The IUPAC name of 6-chloro-5-cyclopropyl-2,3-dihydro-1H-indazole;ethane (CID 177150137) is 6-chloro-5-cyclopropyl-2,3-dihydro-1H-indazole;ethane.
What is the SMILES notation for 6-chloro-5-cyclopropyl-2,3-dihydro-1H-indazole;ethane?
The canonical SMILES for 6-chloro-5-cyclopropyl-2,3-dihydro-1H-indazole;ethane is CC.Clc1cc2c(cc1C1CC1)CNN2.
What is the InChIKey of 6-chloro-5-cyclopropyl-2,3-dihydro-1H-indazole;ethane?
The InChIKey is FYVWSVDHTBSGKK-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H11ClN2.C2H6/c11-9-4-10-7(5-12-13-10)3-8(9)6-1-2-6;1-2/h3-4,6,12-13H,1-2,5H2;1-2H3.
What are the key properties of 6-chloro-5-cyclopropyl-2,3-dihydro-1H-indazole;ethane?
6-chloro-5-cyclopropyl-2,3-dihydro-1H-indazole;ethane has a molecular weight of 224.73 g/mol, XLogP of 3.67, 1 rotatable bonds, 2 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 6-chloro-5-cyclopropyl-2,3-dihydro-1H-indazole;ethane is sourced from PubChem (CID 177150137), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).