C11H12BrF — CID 177150169
2-bromo-1-ethyl-5-fluoro-2,3-dihydro-1H-indene (PubChem CID 177150169) has the molecular formula C11H12BrF and a molecular weight of 243.12 g/mol. Its IUPAC name is 2-bromo-1-ethyl-5-fluoro-2,3-dihydro-1H-indene.
| Compound Name | 2-bromo-1-ethyl-5-fluoro-2,3-dihydro-1H-indene |
|---|---|
| PubChem CID | 177150169 |
| Molecular Formula | C11H12BrF |
| Molecular Weight | 243.12 g/mol |
| Exact Mass | 242.01 |
| IUPAC Name | 2-bromo-1-ethyl-5-fluoro-2,3-dihydro-1H-indene |
| SMILES | CCC1c2ccc(F)cc2CC1Br |
| InChI | InChI=1S/C11H12BrF/c1-2-9-10-4-3-8(13)5-7(10)6-11(9)12/h3-5,9,11H,2,6H2,1H3 |
| InChIKey | LUBHCJSJZDPDPY-UHFFFAOYSA-N |
| XLogP | 3.64 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 1 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 243.12 |
| LogP ≤ 5 | 3.64 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|