C23H39BN2O3 — CID 177150222
4-butan-2-yl-N-(1-ethoxypropyl)-2-methanimidoyl-5-methyl-3-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)aniline (PubChem CID 177150222) has the molecular formula C23H39BN2O3 and a molecular weight of 402.39 g/mol. Its IUPAC name is 4-butan-2-yl-N-(1-ethoxypropyl)-2-methanimidoyl-5-methyl-3-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)aniline.
| Compound Name | 4-butan-2-yl-N-(1-ethoxypropyl)-2-methanimidoyl-5-methyl-3-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)aniline |
|---|---|
| PubChem CID | 177150222 |
| Molecular Formula | C23H39BN2O3 |
| Molecular Weight | 402.39 g/mol |
| Exact Mass | 402.31 |
| IUPAC Name | 4-butan-2-yl-N-(1-ethoxypropyl)-2-methanimidoyl-5-methyl-3-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)aniline |
| SMILES | [H]/N=C/c1c(NC(CC)OCC)cc(C)c(C(C)CC)c1B1OC(C)(C)C(C)(C)O1 |
| InChI | InChI=1S/C23H39BN2O3/c1-10-15(4)20-16(5)13-18(26-19(11-2)27-12-3)17(14-25)21(20)24-28-22(6,7)23(8,9)29-24/h13-15,19,25-26H,10-12H2,1-9H3/b25-14+ |
| InChIKey | BAVRIBQYFSJUKJ-AFUMVMLFSA-N |
| XLogP | 4.99 |
| TPSA | 63.57 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 402.39 |
| LogP ≤ 5 | 4.99 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|