C17H17BrN2OS — CID 177150943
8-bromo-N-(cyclopropylmethylsulfanyl)spiro[4H-benzo[g][1,2]benzoxazole-5,1'-cyclopropane]-3-amine (PubChem CID 177150943) has the molecular formula C17H17BrN2OS and a molecular weight of 377.31 g/mol. Its IUPAC name is 8-bromo-N-(cyclopropylmethylsulfanyl)spiro[4H-benzo[g][1,2]benzoxazole-5,1'-cyclopropane]-3-amine.
| Compound Name | 8-bromo-N-(cyclopropylmethylsulfanyl)spiro[4H-benzo[g][1,2]benzoxazole-5,1'-cyclopropane]-3-amine |
|---|---|
| PubChem CID | 177150943 |
| Molecular Formula | C17H17BrN2OS |
| Molecular Weight | 377.31 g/mol |
| Exact Mass | 376.02 |
| IUPAC Name | 8-bromo-N-(cyclopropylmethylsulfanyl)spiro[4H-benzo[g][1,2]benzoxazole-5,1'-cyclopropane]-3-amine |
| SMILES | Brc1ccc2c(c1)-c1onc(NSCC3CC3)c1CC21CC1 |
| InChI | InChI=1S/C17H17BrN2OS/c18-11-3-4-14-12(7-11)15-13(8-17(14)5-6-17)16(19-21-15)20-22-9-10-1-2-10/h3-4,7,10H,1-2,5-6,8-9H2,(H,19,20) |
| InChIKey | RPIAJXGDRXTJDH-UHFFFAOYSA-N |
| XLogP | 5.16 |
| TPSA | 38.06 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 377.31 |
| LogP ≤ 5 | 5.16 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'sulphur_nitrogen_single_bond', 'substructure': 'N/A'} |
|---|