C18H22N4OS — CID 177151188
8-(azetidin-1-yl)-N-(dimethylaminosulfanyl)spiro[4H-benzo[g][1,2]benzoxazole-5,1'-cyclopropane]-3-amine (PubChem CID 177151188) has the molecular formula C18H22N4OS and a molecular weight of 342.47 g/mol. Its IUPAC name is 8-(azetidin-1-yl)-N-(dimethylaminosulfanyl)spiro[4H-benzo[g][1,2]benzoxazole-5,1'-cyclopropane]-3-amine.
| Compound Name | 8-(azetidin-1-yl)-N-(dimethylaminosulfanyl)spiro[4H-benzo[g][1,2]benzoxazole-5,1'-cyclopropane]-3-amine |
|---|---|
| PubChem CID | 177151188 |
| Molecular Formula | C18H22N4OS |
| Molecular Weight | 342.47 g/mol |
| Exact Mass | 342.15 |
| IUPAC Name | 8-(azetidin-1-yl)-N-(dimethylaminosulfanyl)spiro[4H-benzo[g][1,2]benzoxazole-5,1'-cyclopropane]-3-amine |
| SMILES | CN(C)SNc1noc2c1CC1(CC1)c1ccc(N3CCC3)cc1-2 |
| InChI | InChI=1S/C18H22N4OS/c1-21(2)24-20-17-14-11-18(6-7-18)15-5-4-12(22-8-3-9-22)10-13(15)16(14)23-19-17/h4-5,10H,3,6-9,11H2,1-2H3,(H,19,20) |
| InChIKey | NZPCEBYMAHCQBD-UHFFFAOYSA-N |
| XLogP | 3.68 |
| TPSA | 44.54 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 342.47 |
| LogP ≤ 5 | 3.68 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'sulphur_nitrogen_single_bond', 'substructure': 'N/A'} |
|---|