C11H18N2O — CID 177151244
2,3-diethyl-5-propan-2-ylpyrimidin-4-one (PubChem CID 177151244) has the molecular formula C11H18N2O and a molecular weight of 194.28 g/mol. Its IUPAC name is 2,3-diethyl-5-propan-2-ylpyrimidin-4-one.
| Compound Name | 2,3-diethyl-5-propan-2-ylpyrimidin-4-one |
|---|---|
| PubChem CID | 177151244 |
| Molecular Formula | C11H18N2O |
| Molecular Weight | 194.28 g/mol |
| Exact Mass | 194.14 |
| IUPAC Name | 2,3-diethyl-5-propan-2-ylpyrimidin-4-one |
| SMILES | CCc1ncc(C(C)C)c(=O)n1CC |
| InChI | InChI=1S/C11H18N2O/c1-5-10-12-7-9(8(3)4)11(14)13(10)6-2/h7-8H,5-6H2,1-4H3 |
| InChIKey | JELXYMYHWXUPSV-UHFFFAOYSA-N |
| XLogP | 1.95 |
| TPSA | 34.89 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 194.28 |
| LogP ≤ 5 | 1.95 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |