C16H20N2O2 — CID 177151717
4-amino-N-(4-hydroxy-2-methylbutan-2-yl)naphthalene-1-carboxamide (PubChem CID 177151717) has the molecular formula C16H20N2O2 and a molecular weight of 272.35 g/mol. Its IUPAC name is 4-amino-N-(4-hydroxy-2-methylbutan-2-yl)naphthalene-1-carboxamide.
| Compound Name | 4-amino-N-(4-hydroxy-2-methylbutan-2-yl)naphthalene-1-carboxamide |
|---|---|
| PubChem CID | 177151717 |
| Molecular Formula | C16H20N2O2 |
| Molecular Weight | 272.35 g/mol |
| Exact Mass | 272.15 |
| IUPAC Name | 4-amino-N-(4-hydroxy-2-methylbutan-2-yl)naphthalene-1-carboxamide |
| SMILES | CC(C)(CCO)NC(=O)c1ccc(N)c2ccccc12 |
| InChI | InChI=1S/C16H20N2O2/c1-16(2,9-10-19)18-15(20)13-7-8-14(17)12-6-4-3-5-11(12)13/h3-8,19H,9-10,17H2,1-2H3,(H,18,20) |
| InChIKey | UDOXIUUZGMHOBH-UHFFFAOYSA-N |
| XLogP | 2.31 |
| TPSA | 75.35 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 272.35 |
| LogP ≤ 5 | 2.31 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|