C18H26N4O2 — CID 177152220
but-2-yne;ethane;11-methyl-13-(methylamino)-6-oxa-1,9,12-triazatricyclo[8.4.0.03,8]tetradeca-3(8),9,11,13-tetraen-2-one (PubChem CID 177152220) has the molecular formula C18H26N4O2 and a molecular weight of 330.43 g/mol. Its IUPAC name is but-2-yne;ethane;11-methyl-13-(methylamino)-6-oxa-1,9,12-triazatricyclo[8.4.0.03,8]tetradeca-3(8),9,11,13-tetraen-2-one.
| Compound Name | but-2-yne;ethane;11-methyl-13-(methylamino)-6-oxa-1,9,12-triazatricyclo[8.4.0.03,8]tetradeca-3(8),9,11,13-tetraen-2-one |
|---|---|
| PubChem CID | 177152220 |
| Molecular Formula | C18H26N4O2 |
| Molecular Weight | 330.43 g/mol |
| Exact Mass | 330.21 |
| IUPAC Name | but-2-yne;ethane;11-methyl-13-(methylamino)-6-oxa-1,9,12-triazatricyclo[8.4.0.03,8]tetradeca-3(8),9,11,13-tetraen-2-one |
| SMILES | CC.CC#CC.CNc1cn2c(=O)c3c(nc2c(C)n1)COCC3 |
| InChI | InChI=1S/C12H14N4O2.C4H6.C2H6/c1-7-11-15-9-6-18-4-3-8(9)12(17)16(11)5-10(13-2)14-7;1-3-4-2;1-2/h5,13H,3-4,6H2,1-2H3;1-2H3;1-2H3 |
| InChIKey | HLCDDUQMMDMLKF-UHFFFAOYSA-N |
| XLogP | 2.57 |
| TPSA | 68.52 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 330.43 |
| LogP ≤ 5 | 2.57 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|