About ethane;methane;2-(oxan-3-yl)morpholine
ethane;methane;2-(oxan-3-yl)morpholine (PubChem CID 177152288) has the molecular formula C14H33NO2
and a molecular weight of 247.42 g/mol. Its IUPAC name is ethane;methane;2-(oxan-3-yl)morpholine.
Molecular Properties
| Compound Name | ethane;methane;2-(oxan-3-yl)morpholine |
| PubChem CID | 177152288 |
| Molecular Formula | C14H33NO2 |
| Molecular Weight | 247.42 g/mol |
| Exact Mass | 247.25 |
| IUPAC Name | ethane;methane;2-(oxan-3-yl)morpholine |
| SMILES | C.C1COCC(C2CNCCO2)C1.CC.CC |
| InChI | InChI=1S/C9H17NO2.2C2H6.CH4/c1-2-8(7-11-4-1)9-6-10-3-5-12-9;2*1-2;/h8-10H,1-7H2;2*1-2H3;1H4 |
| InChIKey | WXAHPKIXMGJGKH-UHFFFAOYSA-N |
| XLogP | 3.09 |
| TPSA | 30.49 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 247.42 |
| LogP ≤ 5 | 3.09 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze ethane;methane;2-(oxan-3-yl)morpholine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of ethane;methane;2-(oxan-3-yl)morpholine?
The IUPAC name of ethane;methane;2-(oxan-3-yl)morpholine (CID 177152288) is ethane;methane;2-(oxan-3-yl)morpholine.
What is the SMILES notation for ethane;methane;2-(oxan-3-yl)morpholine?
The canonical SMILES for ethane;methane;2-(oxan-3-yl)morpholine is C.C1COCC(C2CNCCO2)C1.CC.CC.
What is the InChIKey of ethane;methane;2-(oxan-3-yl)morpholine?
The InChIKey is WXAHPKIXMGJGKH-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H17NO2.2C2H6.CH4/c1-2-8(7-11-4-1)9-6-10-3-5-12-9;2*1-2;/h8-10H,1-7H2;2*1-2H3;1H4.
What are the key properties of ethane;methane;2-(oxan-3-yl)morpholine?
ethane;methane;2-(oxan-3-yl)morpholine has a molecular weight of 247.42 g/mol, XLogP of 3.09, 1 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for ethane;methane;2-(oxan-3-yl)morpholine is sourced from PubChem (CID 177152288), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).