C25H32O4 — CID 177152584
3-ethyl-2,5,6-trimethyl-4-(3,4,6-trimethyl-2-propylbenzoyl)oxybenzoic acid (PubChem CID 177152584) has the molecular formula C25H32O4 and a molecular weight of 396.53 g/mol. Its IUPAC name is 3-ethyl-2,5,6-trimethyl-4-(3,4,6-trimethyl-2-propylbenzoyl)oxybenzoic acid.
| Compound Name | 3-ethyl-2,5,6-trimethyl-4-(3,4,6-trimethyl-2-propylbenzoyl)oxybenzoic acid |
|---|---|
| PubChem CID | 177152584 |
| Molecular Formula | C25H32O4 |
| Molecular Weight | 396.53 g/mol |
| Exact Mass | 396.23 |
| IUPAC Name | 3-ethyl-2,5,6-trimethyl-4-(3,4,6-trimethyl-2-propylbenzoyl)oxybenzoic acid |
| SMILES | CCCc1c(C)c(C)cc(C)c1C(=O)Oc1c(C)c(C)c(C(=O)O)c(C)c1CC |
| InChI | InChI=1S/C25H32O4/c1-9-11-20-15(5)13(3)12-14(4)21(20)25(28)29-23-17(7)16(6)22(24(26)27)18(8)19(23)10-2/h12H,9-11H2,1-8H3,(H,26,27) |
| InChIKey | RDZUUXFELFZFHF-UHFFFAOYSA-N |
| XLogP | 5.97 |
| TPSA | 63.60 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 396.53 |
| LogP ≤ 5 | 5.97 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|