C21H26O5 — CID 177152740
(4-hydroperoxy-2,3,5,6-tetramethylphenyl) 3-ethyl-2-hydroxy-4,6-dimethylbenzoate (PubChem CID 177152740) has the molecular formula C21H26O5 and a molecular weight of 358.43 g/mol. Its IUPAC name is (4-hydroperoxy-2,3,5,6-tetramethylphenyl) 3-ethyl-2-hydroxy-4,6-dimethylbenzoate.
| Compound Name | (4-hydroperoxy-2,3,5,6-tetramethylphenyl) 3-ethyl-2-hydroxy-4,6-dimethylbenzoate |
|---|---|
| PubChem CID | 177152740 |
| Molecular Formula | C21H26O5 |
| Molecular Weight | 358.43 g/mol |
| Exact Mass | 358.18 |
| IUPAC Name | (4-hydroperoxy-2,3,5,6-tetramethylphenyl) 3-ethyl-2-hydroxy-4,6-dimethylbenzoate |
| SMILES | CCc1c(C)cc(C)c(C(=O)Oc2c(C)c(C)c(OO)c(C)c2C)c1O |
| InChI | InChI=1S/C21H26O5/c1-8-16-10(2)9-11(3)17(18(16)22)21(23)25-19-12(4)14(6)20(26-24)15(7)13(19)5/h9,22,24H,8H2,1-7H3 |
| InChIKey | WVOCTVNJJOEAID-UHFFFAOYSA-N |
| XLogP | 4.88 |
| TPSA | 75.99 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 358.43 |
| LogP ≤ 5 | 4.88 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'peroxide', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|