C21H22N6O2 — CID 177153123
5-methyl-N-[4-methyl-3-(6-morpholin-4-ylpyrazin-2-yl)phenyl]pyridazine-3-carboxamide (PubChem CID 177153123) has the molecular formula C21H22N6O2 and a molecular weight of 390.45 g/mol. Its IUPAC name is 5-methyl-N-[4-methyl-3-(6-morpholin-4-ylpyrazin-2-yl)phenyl]pyridazine-3-carboxamide.
| Compound Name | 5-methyl-N-[4-methyl-3-(6-morpholin-4-ylpyrazin-2-yl)phenyl]pyridazine-3-carboxamide |
|---|---|
| PubChem CID | 177153123 |
| Molecular Formula | C21H22N6O2 |
| Molecular Weight | 390.45 g/mol |
| Exact Mass | 390.18 |
| IUPAC Name | 5-methyl-N-[4-methyl-3-(6-morpholin-4-ylpyrazin-2-yl)phenyl]pyridazine-3-carboxamide |
| SMILES | Cc1cnnc(C(=O)Nc2ccc(C)c(-c3cncc(N4CCOCC4)n3)c2)c1 |
| InChI | InChI=1S/C21H22N6O2/c1-14-9-18(26-23-11-14)21(28)24-16-4-3-15(2)17(10-16)19-12-22-13-20(25-19)27-5-7-29-8-6-27/h3-4,9-13H,5-8H2,1-2H3,(H,24,28) |
| InChIKey | NHBPTMULESDKGB-UHFFFAOYSA-N |
| XLogP | 2.64 |
| TPSA | 93.13 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 390.45 |
| LogP ≤ 5 | 2.64 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |