C27H30N4O4 — CID 177153336
2-[[(1E)-1-ethylidene-2-[(Z)-ethylideneamino]-4-hydroxy-7-(4-phenylpiperidin-1-yl)isoquinoline-3-carbonyl]amino]acetic acid (PubChem CID 177153336) has the molecular formula C27H30N4O4 and a molecular weight of 474.56 g/mol. Its IUPAC name is 2-[[(1E)-1-ethylidene-2-[(Z)-ethylideneamino]-4-hydroxy-7-(4-phenylpiperidin-1-yl)isoquinoline-3-carbonyl]amino]acetic acid.
| Compound Name | 2-[[(1E)-1-ethylidene-2-[(Z)-ethylideneamino]-4-hydroxy-7-(4-phenylpiperidin-1-yl)isoquinoline-3-carbonyl]amino]acetic acid |
|---|---|
| PubChem CID | 177153336 |
| Molecular Formula | C27H30N4O4 |
| Molecular Weight | 474.56 g/mol |
| Exact Mass | 474.23 |
| IUPAC Name | 2-[[(1E)-1-ethylidene-2-[(Z)-ethylideneamino]-4-hydroxy-7-(4-phenylpiperidin-1-yl)isoquinoline-3-carbonyl]amino]acetic acid |
| SMILES | C/C=N\N1C(C(=O)NCC(=O)O)=C(O)c2ccc(N3CCC(c4ccccc4)CC3)cc2/C1=C\C |
| InChI | InChI=1S/C27H30N4O4/c1-3-23-22-16-20(30-14-12-19(13-15-30)18-8-6-5-7-9-18)10-11-21(22)26(34)25(31(23)29-4-2)27(35)28-17-24(32)33/h3-11,16,19,34H,12-15,17H2,1-2H3,(H,28,35)(H,32,33)/b23-3+,29-4- |
| InChIKey | ANSGVZUYYWOXIF-RYSRWVGFSA-N |
| XLogP | 4.18 |
| TPSA | 105.47 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 474.56 |
| LogP ≤ 5 | 4.18 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'anil_di_alk_B(251)', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|