methyl 5,8-dimethyl-2-phenyl-1,7-naphthyridine-6-carboxylate

C18H16N2O2 — CID 177153656

IUPACmethyl 5,8-dimethyl-2-phenyl-1,7-naphthyridine-6-carboxylate
SMILESCOC(=O)c1nc(C)c2nc(-c3ccccc3)ccc2c1C
InChIInChI=1S/C18H16N2O2/c1-11-14-9-10-15(13-7-5-4-6-8-13)20-17(14)12(2)19-16(11)18(21)22-3/h4-10H,1-3H3
InChIKeyIQZOXWJHRZUGLR-UHFFFAOYSA-N
MW292.34 g/mol
LogP3.70
Rot. Bonds2

About methyl 5,8-dimethyl-2-phenyl-1,7-naphthyridine-6-carboxylate

methyl 5,8-dimethyl-2-phenyl-1,7-naphthyridine-6-carboxylate (PubChem CID 177153656) has the molecular formula C18H16N2O2 and a molecular weight of 292.34 g/mol. Its IUPAC name is methyl 5,8-dimethyl-2-phenyl-1,7-naphthyridine-6-carboxylate.

Molecular Properties

Compound Namemethyl 5,8-dimethyl-2-phenyl-1,7-naphthyridine-6-carboxylate
PubChem CID177153656
Molecular FormulaC18H16N2O2
Molecular Weight292.34 g/mol
Exact Mass292.12
IUPAC Namemethyl 5,8-dimethyl-2-phenyl-1,7-naphthyridine-6-carboxylate
SMILESCOC(=O)c1nc(C)c2nc(-c3ccccc3)ccc2c1C
InChIInChI=1S/C18H16N2O2/c1-11-14-9-10-15(13-7-5-4-6-8-13)20-17(14)12(2)19-16(11)18(21)22-3/h4-10H,1-3H3
InChIKeyIQZOXWJHRZUGLR-UHFFFAOYSA-N
XLogP3.70
TPSA52.08 Ų
H-Bond Donors
H-Bond Acceptors4
Rotatable Bonds2
Heavy Atoms22
Complexity

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500292.34
LogP ≤ 53.70
H-Bond Donors ≤ 50
H-Bond Acceptors ≤ 104

Analyze methyl 5,8-dimethyl-2-phenyl-1,7-naphthyridine-6-carboxylate with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of methyl 5,8-dimethyl-2-phenyl-1,7-naphthyridine-6-carboxylate?
The IUPAC name of methyl 5,8-dimethyl-2-phenyl-1,7-naphthyridine-6-carboxylate (CID 177153656) is methyl 5,8-dimethyl-2-phenyl-1,7-naphthyridine-6-carboxylate.
What is the SMILES notation for methyl 5,8-dimethyl-2-phenyl-1,7-naphthyridine-6-carboxylate?
The canonical SMILES for methyl 5,8-dimethyl-2-phenyl-1,7-naphthyridine-6-carboxylate is COC(=O)c1nc(C)c2nc(-c3ccccc3)ccc2c1C.
What is the InChIKey of methyl 5,8-dimethyl-2-phenyl-1,7-naphthyridine-6-carboxylate?
The InChIKey is IQZOXWJHRZUGLR-UHFFFAOYSA-N. The full InChI is InChI=1S/C18H16N2O2/c1-11-14-9-10-15(13-7-5-4-6-8-13)20-17(14)12(2)19-16(11)18(21)22-3/h4-10H,1-3H3.
What are the key properties of methyl 5,8-dimethyl-2-phenyl-1,7-naphthyridine-6-carboxylate?
methyl 5,8-dimethyl-2-phenyl-1,7-naphthyridine-6-carboxylate has a molecular weight of 292.34 g/mol, XLogP of 3.70, 2 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for methyl 5,8-dimethyl-2-phenyl-1,7-naphthyridine-6-carboxylate is sourced from PubChem (CID 177153656), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).