C32H58O8 — CID 177154373
7-O-tert-butyl 1-O-[1,3-di(octanoyloxy)propan-2-yl] 3,3-dimethylheptanedioate (PubChem CID 177154373) has the molecular formula C32H58O8 and a molecular weight of 570.81 g/mol. Its IUPAC name is 7-O-tert-butyl 1-O-[1,3-di(octanoyloxy)propan-2-yl] 3,3-dimethylheptanedioate.
| Compound Name | 7-O-tert-butyl 1-O-[1,3-di(octanoyloxy)propan-2-yl] 3,3-dimethylheptanedioate |
|---|---|
| PubChem CID | 177154373 |
| Molecular Formula | C32H58O8 |
| Molecular Weight | 570.81 g/mol |
| Exact Mass | 570.41 |
| IUPAC Name | 7-O-tert-butyl 1-O-[1,3-di(octanoyloxy)propan-2-yl] 3,3-dimethylheptanedioate |
| SMILES | CCCCCCCC(=O)OCC(COC(=O)CCCCCCC)OC(=O)CC(C)(C)CCCC(=O)OC(C)(C)C |
| InChI | InChI=1S/C32H58O8/c1-8-10-12-14-16-19-27(33)37-24-26(25-38-28(34)20-17-15-13-11-9-2)39-30(36)23-32(6,7)22-18-21-29(35)40-31(3,4)5/h26H,8-25H2,1-7H3 |
| InChIKey | FMRXYQLSYARHMW-UHFFFAOYSA-N |
| XLogP | 7.63 |
| TPSA | 105.20 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 23 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 570.81 |
| LogP ≤ 5 | 7.63 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|