About 2-(8-methyl-4-oxopyrido[1,2-a]pyrimidin-2-yl)ethyl 2-(trifluoromethyl)benzoate
2-(8-methyl-4-oxopyrido[1,2-a]pyrimidin-2-yl)ethyl 2-(trifluoromethyl)benzoate (PubChem CID 177154417) has the molecular formula C19H15F3N2O3
and a molecular weight of 376.33 g/mol. Its IUPAC name is 2-(8-methyl-4-oxopyrido[1,2-a]pyrimidin-2-yl)ethyl 2-(trifluoromethyl)benzoate.
Molecular Properties
| Compound Name | 2-(8-methyl-4-oxopyrido[1,2-a]pyrimidin-2-yl)ethyl 2-(trifluoromethyl)benzoate |
| PubChem CID | 177154417 |
| Molecular Formula | C19H15F3N2O3 |
| Molecular Weight | 376.33 g/mol |
| Exact Mass | 376.10 |
| IUPAC Name | 2-(8-methyl-4-oxopyrido[1,2-a]pyrimidin-2-yl)ethyl 2-(trifluoromethyl)benzoate |
| SMILES | Cc1ccn2c(=O)cc(CCOC(=O)c3ccccc3C(F)(F)F)nc2c1 |
| InChI | InChI=1S/C19H15F3N2O3/c1-12-6-8-24-16(10-12)23-13(11-17(24)25)7-9-27-18(26)14-4-2-3-5-15(14)19(20,21)22/h2-6,8,10-11H,7,9H2,1H3 |
| InChIKey | DWYFBCKODSUBEK-UHFFFAOYSA-N |
| XLogP | 3.42 |
| TPSA | 60.67 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 376.33 |
| LogP ≤ 5 | 3.42 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze 2-(8-methyl-4-oxopyrido[1,2-a]pyrimidin-2-yl)ethyl 2-(trifluoromethyl)benzoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-(8-methyl-4-oxopyrido[1,2-a]pyrimidin-2-yl)ethyl 2-(trifluoromethyl)benzoate?
The IUPAC name of 2-(8-methyl-4-oxopyrido[1,2-a]pyrimidin-2-yl)ethyl 2-(trifluoromethyl)benzoate (CID 177154417) is 2-(8-methyl-4-oxopyrido[1,2-a]pyrimidin-2-yl)ethyl 2-(trifluoromethyl)benzoate.
What is the SMILES notation for 2-(8-methyl-4-oxopyrido[1,2-a]pyrimidin-2-yl)ethyl 2-(trifluoromethyl)benzoate?
The canonical SMILES for 2-(8-methyl-4-oxopyrido[1,2-a]pyrimidin-2-yl)ethyl 2-(trifluoromethyl)benzoate is Cc1ccn2c(=O)cc(CCOC(=O)c3ccccc3C(F)(F)F)nc2c1.
What is the InChIKey of 2-(8-methyl-4-oxopyrido[1,2-a]pyrimidin-2-yl)ethyl 2-(trifluoromethyl)benzoate?
The InChIKey is DWYFBCKODSUBEK-UHFFFAOYSA-N. The full InChI is InChI=1S/C19H15F3N2O3/c1-12-6-8-24-16(10-12)23-13(11-17(24)25)7-9-27-18(26)14-4-2-3-5-15(14)19(20,21)22/h2-6,8,10-11H,7,9H2,1H3.
What are the key properties of 2-(8-methyl-4-oxopyrido[1,2-a]pyrimidin-2-yl)ethyl 2-(trifluoromethyl)benzoate?
2-(8-methyl-4-oxopyrido[1,2-a]pyrimidin-2-yl)ethyl 2-(trifluoromethyl)benzoate has a molecular weight of 376.33 g/mol, XLogP of 3.42, 4 rotatable bonds, 0 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 2-(8-methyl-4-oxopyrido[1,2-a]pyrimidin-2-yl)ethyl 2-(trifluoromethyl)benzoate is sourced from PubChem (CID 177154417), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).